Files
IQ.Pilot/tinygrad_repo/tinygrad/tensor.py
2026-03-30 21:09:07 -05:00

4143 lines
193 KiB
Python
Raw Permalink Blame History

This file contains ambiguous Unicode characters
This file contains Unicode characters that might be confused with other characters. If you think that this is intentional, you can safely ignore this warning. Use the Escape button to reveal them.
# inspired by https://github.com/karpathy/micrograd/blob/master/micrograd/engine.py
from __future__ import annotations
import time, math, itertools, functools, struct, sys, inspect, pathlib, string, hashlib, weakref
from contextlib import ContextDecorator
from typing import Any, Callable, ClassVar, Sequence, cast, get_args, Literal, SupportsIndex, ParamSpec, TypeVar, Generic, TYPE_CHECKING
if TYPE_CHECKING: import numpy
from tinygrad.dtype import DType, DTypeLike, dtypes, ImageDType, ConstType, least_upper_float, least_upper_dtype, sum_acc_dtype, to_dtype, truncate
from tinygrad.dtype import _from_np_dtype, _to_np_dtype, PyConst
from tinygrad.helpers import argfix, make_tuple, flatten, prod, all_int, round_up, merge_dicts, argsort, getenv, all_same, fully_flatten
from tinygrad.helpers import IMAGE, WINO, Metadata, TRACEMETA, ASM_GEMM, ceildiv, fetch, polyN, is_numpy_ndarray, TracingKey, cpu_profile
from tinygrad.helpers import suppress_finalizing, disable_gc
from tinygrad.gradient import compute_gradient
from tinygrad.mixin import OpMixin
from tinygrad.mixin.movement import _align_left
from tinygrad.uop.ops import smax, smin, resolve, UOp, Ops, sint, identity_element, all_metadata, _index_to_concrete_int, sint_to_uop, Variable
from tinygrad.engine.schedule import ExecItem, complete_create_schedule_with_vars
from tinygrad.device import Device, Buffer
from tinygrad.engine.realize import run_schedule
# TODO: this should be the only usage of Device
def canonicalize_device(device:str|tuple|list|None) -> str|tuple[str, ...]:
return tuple(Device.canonicalize(d) for d in device) if isinstance(device, (tuple, list)) else Device.canonicalize(device)
# *** all in scope Tensors are here. this gets relevant UOps ***
all_tensors: dict[weakref.ref[Tensor], None] = {}
_pending_assigns: dict[UOp, list[UOp]] = {} # buffer_uop -> [assign_uops in insertion order]
def _apply_map_to_tensors(applied_map:dict[UOp, UOp], name:str) -> None:
with cpu_profile(TracingKey(name), "TINY"):
# get tensors in scope
in_scope: dict[UOp, bool] = {}
def visitor(node: UOp) -> bool: return True if node in applied_map else any(in_scope.get(s, False) for s in node.src)
scope_tensors: list[Tensor] = [t for tref in list(all_tensors) if (t:=tref()) is not None and t.uop.topovisit(visitor, in_scope)]
# get all Tensors and apply the map
sink = UOp.sink(*[t.uop for t in scope_tensors])
new_sink = sink.substitute(applied_map, name=f"substitute {name}")
# set the relevant uop to the realized UOps
for t,s,ns in zip(scope_tensors, sink.src, new_sink.src):
if s is ns: continue
t.uop = ns
# **** Tensor helper functions ****
def _fromnp(x: 'numpy.ndarray') -> UOp:
ret = UOp.new_buffer("NPY", x.size, _from_np_dtype(x.dtype))
# fake realize
ret.buffer.allocate(x)
return ret.reshape(x.shape)
def get_shape(x) -> tuple[int, ...]:
# NOTE: str is special because __getitem__ on a str is still a str
if not hasattr(x, "__len__") or not hasattr(x, "__getitem__") or isinstance(x, str) or (hasattr(x, "shape") and x.shape == ()): return ()
if not all_same(subs:=[get_shape(xi) for xi in x]): raise ValueError(f"inhomogeneous shape from {x}")
return (len(subs),) + (subs[0] if subs else ())
def _frompy(x:list|tuple|bytes, dtype:DType) -> UOp:
if isinstance(x, bytes): ret, data = UOp.new_buffer("PYTHON", len(x)//dtype.itemsize, dtype), x
else:
ret = UOp.new_buffer("PYTHON", prod(shape:=get_shape(x)), dtype).reshape(shape)
assert dtype.fmt is not None, f"{dtype=} has None fmt"
truncate_function = truncate[dtype]
data = struct.pack(f"{ret.size}{dtype.fmt}", *[truncate_function(dtypes.as_const(xi, dtype)) for xi in fully_flatten(x)])
# fake realize
ret.buffer.allocate(memoryview(data if Device.DEFAULT != "PYTHON" else bytearray(data)))
return ret
def _get_winograd_matcols(mat, dims:int, shp:tuple[sint, ...], device:str|tuple[str, ...], dtype:DType) -> list[list[Tensor]]:
return [[Tensor.cat(*[Tensor.full(shp[:dim] + (1,) + shp[dim+1:], float(m[k]), device=device, dtype=dtype) for m in mat], dim=dim)
for k in range(len(mat[0]))] for dim in range(dims)]
# winograd conv 3 kernel f(4x4,3x3) see: http://arxiv.org/abs/1509.09308
def _apply_winograd_matrix(mat, t:Tensor, dims:int) -> Tensor:
# multiply mat_1 @ mat_2 @ t with foldable constants, where mat_i acts on vector t along dimension i; roughly kron(mat, mat) @ t
# due to realize-before-expand rule in lazy.py, we must operate in this order: reshape -> expand -> arithmetic
t_ = t.reshape(t.shape[:dims] + (1,) * dims + t.shape[dims:]).expand(t.shape[:dims] + (len(mat),) * dims + t.shape[dims:]) # add output dims
# precalculate mat columns for each dim; prod(itertools.product(matcols)) gives the columns of kron(mat, mat, ...)
matcols = _get_winograd_matcols(mat, dims, t_.shape[dims:], t_.device, t_.dtype)
# multiply each element of t_ by the corresponding stacked column of kron(mat, mat), producing only one view for each element of t
ret = sum(prod(col[idx] for col, idx in zip(matcols, mat_is)) * t_[mat_is] for mat_is in itertools.product(range(len(mat[0])), repeat=dims))
assert isinstance(ret, Tensor), "sum didn't return a Tensor"
return ret
def _broadcast_shape(*shapes:tuple[sint, ...]) -> tuple[sint, ...]:
return tuple(0 if 0 in nth_dim_sizes else smax(nth_dim_sizes) for nth_dim_sizes in zip(*_align_left(*shapes)))
def _masked_setitem(target:Tensor, values:Tensor, mask:Tensor, axes:tuple[int, ...]) -> Tensor:
# reduce such that if mask contains repeated indices the last one remains
for dim in reversed(axes):
mask, values = functools.reduce(lambda x,y: (x[0]|y[0], y[0].where(y[1], x[1])), zip(mask.split(1, dim), values.split(1, dim)))
# remove extra dims from reduce
for dim in reversed(axes): mask, values = mask.squeeze(dim), values.squeeze(dim)
# select from values for each True element in mask else select from target
return mask.where(values, target)
# `(padding_left, padding_right, padding_top, padding_bottom, ...)` -> `(..., (padding_top, padding_bottom), (padding_left, padding_right))`
def _flat_to_grouped(padding:Sequence[sint]) -> tuple[tuple[sint, sint], ...]: return tuple(zip(padding[-2::-2], padding[::-2]))
ReductionStr = Literal["mean", "sum", "none"]
class Tensor(OpMixin):
"""
A `Tensor` is a multi-dimensional matrix containing elements of a single data type.
```python exec="true" session="tensor"
from tinygrad import Tensor, dtypes, nn
import numpy as np
import math
np.set_printoptions(precision=4)
```
"""
__slots__ = "uop", "requires_grad", "grad"
training: ClassVar[bool] = False
def __init__(self, data:PyConst|bytes|list|tuple|UOp|'numpy.ndarray'|pathlib.Path|None,
device:str|tuple|list|None=None, dtype:DTypeLike|None=None, requires_grad:bool|None=None, _force_unique:bool=False):
if device is None and isinstance(data, pathlib.Path): device = f"DISK:{data.resolve()}" # keep it on the disk if device is None
_dtype:DType|None = to_dtype(dtype) if dtype is not None else None
_device:str|tuple[str, ...] = canonicalize_device(device)
del device, dtype
# tensors can have gradients if you have called .backward
self.grad:Tensor|None = None
# NOTE: this can be in three states. False and None: no gradient, True: gradient
# None (the default) will be updated to True if it's put in an optimizer
self.requires_grad:bool|None = requires_grad
# create a UOp from the different types of inputs
if isinstance(data, UOp):
assert _dtype is None or _dtype==data.dtype or data.dtype==dtypes.index, f"dtype mismatch: {_dtype} vs {data.dtype}"
# if data is dtype.index that means that this is a symbolic int and we need to lower it to something we can make a Tensor out of
if data.dtype==dtypes.index: data = _index_to_concrete_int(data)
if data.op is Ops.BIND:
var, val = data.unbind()
# give the bound constant a device
const = UOp.const(var.dtype, val, _device, ())
data = data.replace(src=(var.replace(src=const.src), const))
elif data is None:
data = Tensor(0, device=_device, dtype=_dtype or dtypes.default_float, requires_grad=requires_grad).uop
elif isinstance(data, get_args(PyConst)):
data = (UOp.unique_const if _force_unique or requires_grad else UOp.const)(_dtype or dtypes.from_py(data), data, _device)
elif isinstance(data, bytes): data = _frompy(data, dtypes.uint8 if _dtype is None else _dtype)
elif isinstance(data, (list, tuple)):
if _dtype is None:
if (d := fully_flatten(data)) and all(isinstance(s, bool) for s in d): _dtype = dtypes.bool
else: _dtype = dtypes.default_int if d and all_int(d) else dtypes.default_float # NOTE: this works because all_int([True, False]) is True
if _dtype in [dtypes.bfloat16, *dtypes.fp8s]: data = Tensor(_frompy(data, dtypes.float32), device=_device).cast(_dtype).uop
else: data = _frompy(data, _dtype)
elif is_numpy_ndarray(data):
import numpy as np
assert isinstance(data, np.ndarray), f"expected np.ndarray, got {data}"
if data.shape == ():
data = Tensor(data.item(), device=_device, dtype=_dtype or _from_np_dtype(data.dtype), requires_grad=requires_grad).uop
else:
data = _fromnp(data.astype(npdtype) if _dtype is not None and (npdtype:=_to_np_dtype(_dtype)) is not None else data)
elif isinstance(data, pathlib.Path):
_dtype = _dtype or dtypes.uint8
data = UOp.new_buffer(f"DISK:{data.resolve()}", data.stat().st_size // _dtype.itemsize, _dtype)
# by this point, it has to be a UOp
if not isinstance(data, UOp): raise RuntimeError(f"can't create Tensor from {data!r} with type {type(data)}")
# data might be on a different device
if isinstance(_device, str): self.uop:UOp = data if data.device == _device else data.copy_to_device(_device)
# if device is a tuple, we should have/construct a multi-device UOp
elif isinstance(data.device, str): self.uop = Tensor(data).shard(_device).uop
else:
assert data.device == _device, f"multi-device UOp device mismatch, {data.device} != {_device}"
self.uop = data
# add to all_tensors after construction succeeds
all_tensors[weakref.ref(self)] = None
@suppress_finalizing
def __del__(self): all_tensors.pop(weakref.ref(self), None)
def _apply_uop(self, fxn:Callable[..., UOp], *x:Tensor, extra_args=(), **kwargs) -> Tensor:
srcs = (self,)+x
new_uop: UOp = fxn(*[t.uop for t in srcs], *extra_args, **kwargs)
if TRACEMETA >= 1 and (metadata:=_METADATA.get()) is not None: all_metadata[new_uop] = (metadata,)
needs_input_grad = [t.requires_grad for t in srcs]
# directly create the Tensor
ret = Tensor.__new__(Tensor)
ret.uop, ret.grad = new_uop, None
ret.requires_grad = True if any(needs_input_grad) else None if None in needs_input_grad else False
# add to all_tensors after construction succeeds
all_tensors[weakref.ref(ret)] = None
return ret
def _apply_broadcasted_uop(self, fxn:Callable, x:Tensor|ConstType, reverse=False) -> Tensor:
lhs,rhs = self._broadcasted(x, reverse)
return lhs._apply_uop(fxn, rhs)
# _binop and alu are used by MathMixin
def _binop(self, op, x, reverse): return self._apply_broadcasted_uop(lambda *u: UOp.alu(u[0], op, *u[1:]), x, reverse)
def alu(self, op: Ops, *src: Tensor) -> Tensor: return self._apply_uop(lambda *u: u[0].alu(op, *u[1:]), *src)
def requires_grad_(self, requires_grad=True) -> Tensor:
# make the UOp unique if it's a CONST to prevent gradient accumulation bugs with cached const UOps
if requires_grad and self.uop.op is Ops.CONST: self.replace(Tensor(self.uop.arg, device=self.device, dtype=self.dtype, requires_grad=True))
self.requires_grad = requires_grad
return self
class train(ContextDecorator):
def __init__(self, mode:bool = True): self.mode = mode
def __enter__(self): self.prev, Tensor.training = Tensor.training, self.mode
def __exit__(self, exc_type, exc_value, traceback): Tensor.training = self.prev
def __repr__(self):
ld = self.uop
ld_repr = f"<UOp {ld.device} {ld.shape} {str(ld.dtype)[7:]}>"
return f"<Tensor {ld_repr} on {self.device} with grad {(self.grad.uop if self.grad is not None else None)!r}>"
# Python has a non moving GC, so this should be okay
def __hash__(self): return id(self)
def __bool__(self): raise TypeError("__bool__ on Tensor is not defined")
def __len__(self):
if not self.shape: raise TypeError("len() of a 0-d tensor")
return self.shape[0]
@property
def device(self) -> str|tuple[str, ...]: return self.uop.device
@property
def shape(self) -> tuple[sint, ...]: return self.uop.shape
@property
def dtype(self) -> DType: return self.uop.dtype
# ***** data handlers ****
def as_param(self, slot:int):
if self.uop.axis is not None:
param = UOp.param(slot, self.dtype, self.uop.shard_shape, self.device).multi(self.uop.axis)
else:
param = UOp.param(slot, self.dtype, self.shape, self.device)
return Tensor(param, device=self.device)
def call(self, *lst:Tensor, fxn:Tensor|UOp, grad_fxn:Callable|None=None) -> Tensor:
return Tensor((fxn.uop if isinstance(fxn, Tensor) else fxn).call(*[t.uop for t in (self,)+lst], grad_fxn=grad_fxn), device=self.device)
def custom_kernel(self, *lst:Tensor, fxn:Callable, grad_fxn:Callable|None=None) -> list[Tensor]:
"""
Call into a custom kernel written in UOps. Returns the Tensors after the Kernel has been applied.
This API is alpha and may change.
"""
return [Tensor(u, device=u.device) for u in UOp.custom_kernel(*[t.uop for t in (self,)+lst], fxn=fxn, grad_fxn=grad_fxn)]
def schedule_with_vars(self, *lst:Tensor) -> tuple[list[ExecItem], dict[str, int]]:
"""
Creates the schedule needed to realize these Tensor(s), with Variables.
NOTE: A Tensor can only be scheduled once.
"""
big_sink = UOp.sink(*[x.uop for x in (self,)+lst])
# this is where the schedule cache should go
becomes_map, schedule, var_vals = complete_create_schedule_with_vars(big_sink)
_apply_map_to_tensors(becomes_map, name="Apply Schedule Map")
return schedule, var_vals
def schedule(self, *lst:Tensor) -> list[ExecItem]:
"""Creates the schedule needed to realize these Tensor(s)."""
schedule, var_vals = self.schedule_with_vars(*lst)
assert len(var_vals) == 0
return schedule
@disable_gc()
def realize(self, *lst:Tensor, do_update_stats=True) -> Tensor:
"""Triggers the computation needed to create these Tensor(s)."""
# side-realize pending assigns for buffers referenced by these tensors
if _pending_assigns:
def _realize_pending(buf):
for assign_uop in _pending_assigns.pop(buf, []):
# recursively realize pending assigns that this assign's value depends on
for u in assign_uop.toposort():
if u.op is Ops.BUFFER and u in _pending_assigns: _realize_pending(u)
becomes_map, schedule, var_vals = complete_create_schedule_with_vars(UOp.sink(assign_uop))
_apply_map_to_tensors(becomes_map, name="Apply Pending Assign")
run_schedule(schedule, var_vals, do_update_stats=do_update_stats)
# update remaining pending assigns so they reference realized buffers instead of stale lazy graphs
if becomes_map:
for assigns in _pending_assigns.values():
for i in range(len(assigns)): assigns[i] = assigns[i].substitute(becomes_map)
for buf in {u for t in (self,)+lst for u in t.uop.toposort() if u.op is Ops.BUFFER}:
if buf in _pending_assigns: _realize_pending(buf)
if len(to_realize:=[x for x in (self,)+lst if not x.uop.has_buffer_identity()]):
run_schedule(*Tensor.schedule_with_vars(*to_realize), do_update_stats=do_update_stats)
return self
def replace(self, x:Tensor) -> Tensor:
"""
Replaces the data of this tensor with the data of another tensor. Only the shape of the tensors must match.
"""
# used for replacing a Tensor with a new version of it (potentially with a different device and dtype)
assert self.shape == x.shape, f"replace shape mismatch {self.shape} != {x.shape}"
self.uop = x.uop
return self
def assign(self, x:Tensor|PyConst|list|tuple) -> Tensor:
is_disk = isinstance(self.device, str) and self.device.startswith("DISK")
if not isinstance(x, Tensor): x = Tensor(x, device="CPU" if is_disk else self.device, dtype=self.dtype)
if self.uop is x.uop: return self # a self assign is a NOOP
# broadcast x (shape only, dtype must match)
if self.shape != x.shape: x = x._broadcast_to(self.shape)
if self.shape != x.shape: raise RuntimeError(f"assign shape mismatch {self.shape} != {x.shape}")
if not is_disk and self.device != x.device: raise RuntimeError(f"assign device mismatch {self.device} != {x.device}")
if self.dtype != x.dtype: raise RuntimeError(f"assign dtype mismatch {self.dtype} != {x.dtype}")
if isinstance(self.device, tuple) and self.uop.axis != x.uop.axis: raise RuntimeError(f"multi axis mismatch {self.uop.axis} != {x.uop.axis}")
# TODO: this is a hack for writing to DISK. remove with working assign
if is_disk:
self._buffer().copyin(x._data())
return self
result = self._apply_uop(UOp.assign, x)
# track view assigns (not full-buffer or assign-chain) so they can be side-realized when the buffer is read
if (buf_uop:=self.uop.base).op is Ops.BUFFER and self.uop.op is not Ops.ASSIGN and not self.uop.has_buffer_identity():
# deduplicate: if the value is already a pending assign for this buffer (e.g. __iadd__ in __setitem__), remove it
if x.uop in _pending_assigns.get(buf_uop, []): _pending_assigns[buf_uop].remove(x.uop)
_pending_assigns.setdefault(buf_uop, []).append(result.uop)
return self.replace(result)
def detach(self) -> Tensor:
"""
Returns a new tensor with the same data as this tensor, but detached from the autograd graph.
"""
return Tensor(self.uop.detach(), device=self.device, requires_grad=False)
def _buffer(self) -> Buffer:
from tinygrad.engine.realize import capturing
if capturing and not getenv("UNSAFE_ALLOW_JIT_BUFFER"):
from tinygrad.engine.jit import JitError
raise JitError("cannot access tensor data during JIT capture, the value will be baked in")
x = self.cast(self.dtype.base).contiguous()
if isinstance(self.device, tuple): x = x.to("CPU")
return cast(Buffer, x.realize().uop.base.buffer).ensure_allocated()
def _data(self) -> memoryview: return self._buffer().as_memoryview()
def data(self) -> memoryview:
"""
Returns the data of this tensor as a memoryview.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([1, 2, 3, 4])
print(np.frombuffer(t.data(), dtype=np.int32))
```
"""
if 0 in self.shape: return memoryview(bytearray(0)).cast(self.dtype.base.fmt)
assert all_int(self.shape), f"no data if shape is symbolic, {self.shape=}"
assert self.dtype.base.fmt is not None, f"no fmt dtype for {self.dtype.base}"
assert self.dtype.base.fmt != "e" or sys.version_info >= (3, 12)
return self._buffer().as_memoryview().cast(self.dtype.base.fmt, self.shape)
def item(self) -> PyConst:
"""
Returns the value of this tensor as a standard Python number.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor(42)
print(t.item())
```
"""
assert self.numel() == 1, "must have one element for item"
return self.data()[(0,) * len(self.shape)]
# NOTE: list[Any] because return type is recursive (list[list[...]] for higher dimensions)
def tolist(self) -> PyConst|list[Any]:
"""
Returns the value of this tensor as a nested list.
Returns single value for const tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([1, 2, 3, 4])
print(t.tolist())
```
```python exec="true" source="above" session="tensor" result="python"
t = Tensor(5)
print(t.tolist())
```
"""
# TODO: remove half once minimum python supports it
if self.dtype in (dtypes.half, dtypes.bfloat16, *dtypes.fp8s): return self.cast(dtypes.float32).tolist()
return self.data().tolist()
def numpy(self) -> 'numpy.ndarray':
"""
Returns the value of this tensor as a `numpy.ndarray`.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([1, 2, 3, 4])
print(repr(t.numpy()))
```
"""
assert all_int(self.shape), f"no data if shape is symbolic, {self.shape=}"
import numpy as np
if self.dtype.base in { dtypes.bfloat16, *dtypes.fp8s }: return self.float().numpy()
if 0 in self.shape: return np.empty(self.shape, dtype=_to_np_dtype(self.dtype.base))
return self._buffer().numpy().reshape(self.shape)
def clone(self) -> Tensor:
"""
Creates a clone of this tensor allocating a separate buffer for the data.
"""
ret = Tensor.empty(self.shape, device=self.device, dtype=self.dtype)
if self.grad is not None: ret.grad = self.grad.clone()
return ret.assign(self)
def to(self, device:str|tuple[str, ...]|None) -> Tensor:
"""
Moves the tensor to the given device.
"""
device = canonicalize_device(device)
if device == self.device: return self
if not isinstance(device, str): return self.shard(device)
ret = Tensor(self.uop, device, requires_grad=self.requires_grad)
if self.grad is not None: ret.grad = self.grad.to(device)
return ret
def to_(self, device:str|tuple[str, ...]|None) -> Tensor:
"""
Moves the tensor to the given device in place.
"""
real = self.to(device)
if self.grad is not None and real.grad is not None: self.grad.replace(real.grad)
return self.replace(real)
def shard(self, devices:tuple[str, ...], axis:int|None=None) -> Tensor:
"""
Shards the tensor across the given devices. Optionally specify which axis to shard on.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.empty(2, 4)
print(t.shard((t.device, t.device), axis=1).uop)
```
"""
if not isinstance(self.device, str): raise RuntimeError("can't shard a multi-device tensor")
if len(devices) == 1: return self.to(devices[0])
devices = cast(tuple[str, ...], canonicalize_device(devices))
mlb = self.uop.shard(devices, self._resolve_dim(axis)) if axis is not None else self.uop.copy_to_device(devices)
return Tensor(mlb, device=devices, requires_grad=self.requires_grad)
def shard_(self, devices:tuple[str, ...], axis:int|None=None) -> Tensor:
"""
Shards the tensor across the given devices in place.
"""
return self.replace(self.shard(devices, axis))
def shard_like(self, y:Tensor) -> Tensor:
"""
Shards the tensor the same way as `y` (same devices and axis).
"""
if isinstance(y.device, str): return self.to(y.device)
return self if isinstance(self.device, tuple) and (y.device, y.uop.axis) == (self.device, self.uop.axis) else self.shard(y.device, y.uop.axis)
CHUNK_SIZE = 2**20
def fs_load(self, size:int) -> Tensor:
"""
Load a tensor from storage.
self should be a tensor of the hash to load
"""
# TODO: this should work locally as well
assert self.dtype == dtypes.uint8, "hash is expected to be uint8"
h = self.contiguous().flatten()
assert h.shape[0] == 16, "expected hash"
base_chunks = math.ceil(size / Tensor.CHUNK_SIZE)
tree_depth = math.ceil(math.log(base_chunks, Tensor.CHUNK_SIZE // 16))
data, level_chunks = h, 0
for i in reversed(range(tree_depth + 1)):
data = data.to("tinyfs:load")
# if not last level, its still hashes
if i > 0 or tree_depth == 0:
level_chunks = max(1, math.ceil(base_chunks / (Tensor.CHUNK_SIZE // 16)**(i-1)))
pad_amt = 16 * level_chunks
else: pad_amt = Tensor.CHUNK_SIZE * level_chunks
if (tsize := data.shape[0]) < pad_amt: data = data.pad((0, pad_amt - tsize))
data = data[:pad_amt].contiguous()
if i != 0: data = data.to(self.device)
return data[:size]
def fs_store(self) -> Tensor:
"""
Store a tensor to storage.
"""
# TODO: this should work locally as well
data = self.contiguous().flatten().bitcast(dtypes.uint8)
# pad to a multiple of 1mb
if (tsize := data.shape[0]) % Tensor.CHUNK_SIZE != 0: data = data.pad((0, Tensor.CHUNK_SIZE - tsize % Tensor.CHUNK_SIZE))
size = data.shape[0]
base_chunks = math.ceil(size / Tensor.CHUNK_SIZE)
tree_depth = math.ceil(math.log(base_chunks, Tensor.CHUNK_SIZE // 16))
to_device = "CPU" if isinstance(self.device, str) and self.device.startswith("DISK") else self.device
level_chunks = base_chunks
for _ in range(tree_depth + 1):
data = data.to("tinyfs:store")[:level_chunks * 16].contiguous().to(to_device)
if (tsize := data.shape[0]) % Tensor.CHUNK_SIZE != 0: data = data.pad((0, Tensor.CHUNK_SIZE - tsize % Tensor.CHUNK_SIZE))
level_chunks = math.ceil(data.shape[0] / Tensor.CHUNK_SIZE)
return data[:16].contiguous()
@staticmethod
def from_uop(y:UOp, **kwargs) -> Tensor:
if y.op is Ops.BIND: return Tensor(y, **kwargs, requires_grad=False)
if y.op is Ops.CONST: return Tensor(y.arg, **kwargs, requires_grad=False)
if y.op is Ops.MUL: return Tensor.from_uop(y.src[0]) * Tensor.from_uop(y.src[1])
if y.op is Ops.ADD: return Tensor.from_uop(y.src[0]) + Tensor.from_uop(y.src[1])
raise RuntimeError(f"unhandled UOp {y}")
# ***** creation entrypoint *****
@staticmethod
def empty(*shape, device:str|tuple[str, ...]|None=None, dtype:DTypeLike|None=None, **kwargs) -> Tensor:
"""
Creates an empty tensor with the given shape.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.empty(2, 3)
print(t.shape)
```
"""
dtype, shape = to_dtype(dtype) if dtype is not None else dtypes.default_float, argfix(*shape)
if not isinstance(size:=prod([x.vmax if isinstance(x, UOp) else x for x in shape]), int): raise ValueError(f"size must be int {size}")
# TODO: add test for multidevice tensor
device = canonicalize_device(device)
return Tensor(UOp.new_buffer(device, size, dtype), device, dtype, **kwargs).shrink(((0,prod(shape)),)).reshape(shape)
def empty_like(self, **kwargs) -> Tensor:
"""
Creates an empty tensor with the same shape as `self`.
If `dtype` is not specified, the dtype of `self` is used.
"""
return Tensor.empty(self.shape, dtype=kwargs.pop("dtype", self.dtype), device=kwargs.pop("device", self.device), **kwargs)
@staticmethod
def from_blob(ptr:int, shape:tuple[int, ...], **kwargs) -> Tensor:
"""
Exposes the pointer as a Tensor without taking ownership of the original data.
The pointer must remain valid for the entire lifetime of the created Tensor.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
"""
r = Tensor.empty(*shape, **kwargs)
assert isinstance(r.device, str)
cast(Buffer, r.uop.buffer).allocate(external_ptr=ptr)
return r
@staticmethod
def from_url(url:str, gunzip:bool=False, **kwargs) -> Tensor:
"""
Creates a Tensor from a URL.
This is the preferred way to access Internet resources.
It currently returns a DISK Tensor, but in the future it may return an HTTP Tensor.
This also will soon become lazy (when possible) and not print progress without DEBUG.
The `gunzip` flag will gzip extract the resource and return an extracted Tensor.
"""
return Tensor(fetch(url, gunzip=gunzip), **kwargs)
_seed: int = int(time.time())
_device_seeds: dict[str, Tensor] = {}
_device_rng_counters: dict[str, Tensor] = {}
@staticmethod
def manual_seed(seed=0) -> None:
"""
Sets the seed for random operations.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
print(Tensor.rand(5).numpy())
print(Tensor.rand(5).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42) # reset to the same seed
print(Tensor.rand(5).numpy())
print(Tensor.rand(5).numpy())
```
"""
Tensor._seed, Tensor._device_seeds, Tensor._device_rng_counters = seed, {}, {}
@staticmethod
def _threefry_random_bits(key:Tensor, counts0:Tensor, counts1:Tensor) -> Tensor:
x = (counts1.cast(dtypes.uint64) << 32) | counts0.cast(dtypes.uint64)
x = x._apply_uop(UOp.threefry, (key[1]._broadcast_to(x.shape).cast(dtypes.uint64) << 32) | key[0]._broadcast_to(x.shape).cast(dtypes.uint64))
counts0, counts1 = (x & 0xffffffff).cast(dtypes.uint32), ((x >> 32) & 0xffffffff).cast(dtypes.uint32)
return counts0.cat(counts1)
@staticmethod
def rand(*shape, device:str|None=None, dtype:DTypeLike|None=None, contiguous:bool=True, **kwargs) -> Tensor:
"""
Creates a tensor with the given shape, filled with random values from a uniform distribution over the interval `[0, 1)`.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor.rand(2, 3)
print(t.numpy())
```
"""
if not dtypes.is_float(dtype := to_dtype(dtype or dtypes.default_float)): raise ValueError(f"rand only supports float dtypes, got {dtype}")
if not all_int(shape:=argfix(*shape)) or not all(s >= 0 for s in shape): raise ValueError(f"invalid input {shape=}")
if device is not None and not isinstance(device, str): raise ValueError(f"rand only supports single device, got {device=}")
device = cast(str, canonicalize_device(device))
# if shape has 0, return zero tensor
if (numel := prod(shape)) == 0: return Tensor.zeros(shape, device=device, dtype=dtype, **kwargs)
num = ceildiv(numel * dtype.itemsize, 4)
# generate per device seeds and rng counter if we haven't seen this device yet
if device not in Tensor._device_seeds:
Tensor._device_seeds[device] = Tensor(
[int.from_bytes(hashlib.sha256(len(Tensor._device_seeds).to_bytes(4, "big")).digest(), "big"), Tensor._seed],
device=device, dtype=dtypes.uint32, requires_grad=False)
Tensor._device_rng_counters[device] = Tensor([num], device=device, dtype=dtypes.uint32, requires_grad=False)
# increment rng counter for devices
else: Tensor._device_rng_counters[device].assign(Tensor._device_rng_counters[device] + num)
# threefry random bits
bits_count = Tensor._device_rng_counters[device] - num
counts0 = (Tensor.arange(ceildiv(num, 2), device=device, dtype=dtypes.uint32, requires_grad=False)+bits_count)
counts1 = counts0 + ceildiv(num, 2)
bits = Tensor._threefry_random_bits(Tensor._device_seeds[device], counts0, counts1)[:num]
# bitcast to uint with same number of bits
_, nmant = dtypes.finfo(dtype)
uint_dtype = {1: dtypes.uint8, 2: dtypes.uint16, 4: dtypes.uint32, 8: dtypes.uint64}[dtype.itemsize]
bits = bits.bitcast(uint_dtype)
# only randomize the mantissa bits and set the exponent to 1
one = Tensor.ones_like(bits, device=bits.device, dtype=dtype).bitcast(uint_dtype)
bits = bits.rshift(dtype.bitsize - nmant).bitwise_or(one)
# bitcast back to the original dtype and reshape
out = bits.bitcast(dtype)[:numel].sub(1).reshape(shape).requires_grad_(kwargs.get("requires_grad"))
return out.contiguous() if contiguous else out
# ***** creation helper functions *****
@staticmethod
def full(shape:tuple[sint, ...], fill_value:PyConst, **kwargs) -> Tensor:
"""
Creates a tensor with the given shape, filled with the given value.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.full((2, 3), 42).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.full((2, 3), False).numpy())
```
"""
return Tensor(fill_value, _force_unique=True, **kwargs).reshape((1, )*len(new_shape := argfix(shape))).expand(new_shape)
@staticmethod
def zeros(*shape, **kwargs) -> Tensor:
"""
Creates a tensor with the given shape, filled with zeros.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.zeros(2, 3).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.zeros(2, 3, dtype=dtypes.int32).numpy())
```
"""
return Tensor.full(argfix(*shape), 0.0, **kwargs)
@staticmethod
def ones(*shape, **kwargs) -> Tensor:
"""
Creates a tensor with the given shape, filled with ones.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.ones(2, 3).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.ones(2, 3, dtype=dtypes.int32).numpy())
```
"""
return Tensor.full(argfix(*shape), 1.0, **kwargs)
@staticmethod
def arange(start, stop=None, step=1, **kwargs) -> Tensor:
"""
Returns a 1-D tensor of size `ceil((stop - start) / step)` with values from `[start, stop)`, with spacing between values given by `step`.
If `stop` is not specified, values are generated from `[0, start)` with the given `step`.
If `stop` is specified, values are generated from `[start, stop)` with the given `step`.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.arange(5).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.arange(5, 10).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.arange(5, 10, 2).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.arange(5.5, 10, 2).numpy())
```
"""
if stop is None: stop, start = start, 0
dtype = kwargs.pop("dtype", dtypes.default_float if any(isinstance(x, float) for x in (start, stop, step)) else dtypes.default_int)
if start < (dt:=to_dtype(dtype)).min or dt.max < (stop-step): raise ValueError(f"arange [{start}, {stop}) is not representable in dtype {dtype}")
# NOTE: this matches numpy, torch raises RuntimeError if stop-start and step have different signs
if (output_len:=ceildiv(stop-start, step)) <= 0: return Tensor([], dtype=dtype, **kwargs)
return (Tensor.full((output_len,), step, dtype=dtype, **kwargs)._cumalu(0, Ops.ADD) + (start - step)).cast(dtype)
@staticmethod
def linspace(start:int|float, stop:int|float, steps:int, **kwargs) -> Tensor:
"""
Returns a 1-D tensor of `steps` evenly spaced values from `start` to `stop`, inclusive.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.linspace(0, 10, 5).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.linspace(-1, 1, 5).numpy())
```
"""
if steps < 0: raise ValueError("number of steps must be non-negative")
if (dtype := to_dtype(kwargs.pop("dtype", dtypes.default_float))) == dtypes.bool: raise ValueError("linspace with bool dtype is not supported")
if steps == 1: return Tensor([start], dtype=dtype, **kwargs)
return (start + Tensor.arange(steps, **kwargs) * ((stop - start) / (steps - 1))).cast(dtype)
@staticmethod
def eye(n:int, m:int|None=None, dtype=None, device=None, requires_grad:bool|None=None) -> Tensor:
"""
Returns a 2-D tensor with `n` rows and `m` columns, with ones on the diagonal and zeros elsewhere.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.eye(3).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.eye(2, 4).numpy())
```
"""
if n < 0 or ((m := n if m is None else m) < 0): raise ValueError(f"cannot have negative {n=}, {m=}")
t = (Tensor.arange(n, device=device).unsqueeze(-1) == Tensor.arange(m, device=device))
return t.cast(dtype or dtypes.default_float).requires_grad_(requires_grad)
def _multi_like(self, fxn, *args, **kwargs) -> Tensor:
dtype = kwargs.pop("dtype", self.dtype)
if kwargs.get("device") is not None: raise RuntimeError("cannot specify `device` on `*_like` of a multi device tensor")
if self.uop.axis is None: return fxn(self.shape, *args, dtype=dtype, **kwargs).shard(self.device)
stacked = UOp(Ops.MSTACK, dtype=dtype, src=tuple([fxn(self.uop.shard_shape, *args, device=d, dtype=dtype, **kwargs).uop for d in self.device]))
return Tensor(UOp.multi(stacked, axis=self.uop.axis), device=self.device, dtype=dtype)
def full_like(self, fill_value:PyConst, **kwargs) -> Tensor:
"""
Creates a tensor with the same shape as `self`, filled with the given value.
If `dtype` is not specified, the dtype of `self` is used.
You can pass in the `device` keyword argument to control device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.ones(2, 3)
print(Tensor.full_like(t, 42).numpy())
```
"""
if isinstance(self.device, tuple): return self._multi_like(Tensor.full, fill_value, **kwargs)
return Tensor.full(self.shape, fill_value, dtype=kwargs.pop("dtype", self.dtype), device=kwargs.pop("device", self.device), **kwargs)
def zeros_like(self, **kwargs) -> Tensor:
"""
Creates a tensor with the same shape as `self`, filled with zeros.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.ones(2, 3)
print(Tensor.zeros_like(t).numpy())
```
"""
return self.full_like(0, **kwargs)
def ones_like(self, **kwargs) -> Tensor:
"""
Creates a tensor with the same shape as `self`, filled with ones.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.zeros(2, 3)
print(Tensor.ones_like(t).numpy())
```
"""
return self.full_like(1, **kwargs)
def rand_like(self, **kwargs) -> Tensor:
"""
Creates a tensor with the same shape and sharding as `self`, filled with random values from a uniform distribution over the interval `[0, 1)`.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.ones(2, 3)
print(Tensor.rand_like(t).numpy())
```
"""
if isinstance(self.device, tuple): return self._multi_like(Tensor.rand, **kwargs)
return Tensor.rand(*self.shape, device=kwargs.pop("device", self.device), dtype=kwargs.pop("dtype", self.dtype), **kwargs)
# ***** rng hlops *****
def randn_like(self, dtype:DTypeLike|None=None, requires_grad:bool|None=None, **kwargs) -> Tensor:
"""
Creates a tensor with the same shape and sharding as `self`, filled with random values from a normal distribution with mean 0 and variance 1.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.ones(2, 3)
print(Tensor.randn_like(t).numpy())
```
"""
src = self.stack(self).rand_like(**{**kwargs, "dtype": dtypes.float32})
# https://en.wikipedia.org/wiki/Box%E2%80%93Muller_transform
return (src[0].mul(2*math.pi).cos().mul((1 - src[1]).log().mul(-2).sqrt()).cast(dtype or self.dtype)).requires_grad_(requires_grad)
@staticmethod
def randn(*shape, dtype:DTypeLike|None=None, requires_grad:bool|None=None, **kwargs) -> Tensor:
"""
Creates a tensor with the given shape, filled with random values from a normal distribution with mean `0` and standard deviation `1`.
If `dtype` is not specified, the default type is used.
You can pass in the `device` keyword argument to control device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
print(Tensor.randn(2, 3).numpy())
```
"""
return Tensor.empty(*shape, **kwargs).randn_like(dtype=dtype, requires_grad=requires_grad)
@staticmethod
def randint(*shape, low=0, high=10, dtype=dtypes.int32, **kwargs) -> Tensor:
"""
Creates a tensor with the given shape, filled with random integer values generated uniformly from the interval `[low, high)`.
If `dtype` is not specified, the default type is used.
You can pass in the `device` keyword argument to control device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
print(Tensor.randint(2, 3, low=5, high=10).numpy())
```
"""
if not isinstance(low, int) or not isinstance(high, int): raise TypeError(f"{low=} and {high=} must be integers")
dtype = to_dtype(dtype)
if not dtypes.is_int(dtype): raise TypeError(f"{dtype=} must be int")
return Tensor.uniform(*shape, low=low, high=high, dtype=dtype, **kwargs)
@staticmethod
def normal(*shape, mean=0.0, std=1.0, requires_grad:bool|None=None, **kwargs) -> Tensor:
"""
Creates a tensor with the given shape, filled with random values from a normal distribution with the given `mean` and standard deviation `std`.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
print(Tensor.normal(2, 3, mean=10, std=2).numpy())
```
"""
return ((std * Tensor.randn(*shape, **kwargs)) + mean).requires_grad_(requires_grad)
@staticmethod
def uniform(*shape, low=0.0, high=1.0, dtype:DTypeLike|None=None, requires_grad:bool|None=None, **kwargs) -> Tensor:
"""
Creates a tensor with the given shape, filled with random values from a uniform distribution over the interval `[low, high)`.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
print(Tensor.uniform(2, 3, low=2, high=10).numpy())
```
"""
return (((high-low) * Tensor.rand(*shape, **kwargs)).cast(dtype or dtypes.default_float) + low).requires_grad_(requires_grad)
@staticmethod
def scaled_uniform(*shape, **kwargs) -> Tensor:
"""
Creates a tensor with the given shape, filled with random values from a uniform distribution
over the interval `[-prod(shape)**-0.5, prod(shape)**-0.5)`.
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
print(Tensor.scaled_uniform(2, 3).numpy())
```
"""
return Tensor.uniform(*shape, low=-1.0, high=1.0, **kwargs).mul(prod(argfix(*shape))**-0.5)
# https://www.tensorflow.org/api_docs/python/tf/keras/initializers/GlorotUniform
@staticmethod
def glorot_uniform(*shape, **kwargs) -> Tensor:
"""
<https://www.tensorflow.org/api_docs/python/tf/keras/initializers/GlorotUniform>
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
print(Tensor.glorot_uniform(2, 3).numpy())
```
"""
return Tensor.uniform(*shape, low=-1.0, high=1.0, **kwargs).mul((6/(argfix(*shape)[0]+prod(argfix(*shape)[1:])))**0.5)
# https://pytorch.org/docs/stable/_modules/torch/nn/init.html#kaiming_uniform_
@staticmethod
def kaiming_uniform(*shape, a:float = 0.01, **kwargs) -> Tensor:
"""
<https://pytorch.org/docs/stable/_modules/torch/nn/init.html#kaiming_uniform_>
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
print(Tensor.kaiming_uniform(2, 3).numpy())
```
"""
bound = math.sqrt(3.0) * math.sqrt(2.0 / (1 + a ** 2)) / math.sqrt(prod(argfix(*shape)[1:]))
return Tensor.uniform(*shape, low=-bound, high=bound, **kwargs)
# https://pytorch.org/docs/stable/_modules/torch/nn/init.html#kaiming_normal_
@staticmethod
def kaiming_normal(*shape, a:float = 0.01, **kwargs) -> Tensor:
"""
<https://pytorch.org/docs/stable/_modules/torch/nn/init.html#kaiming_normal_>
You can pass in `dtype` and `device` keyword arguments to control the data type and device of the tensor.
Additionally, all other keyword arguments are passed to the constructor of the tensor.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
print(Tensor.kaiming_normal(2, 3).numpy())
```
"""
std = math.sqrt(2.0 / (1 + a ** 2)) / math.sqrt(prod(argfix(*shape)[1:]))
return Tensor.normal(*shape, mean=0.0, std=std, **kwargs)
@staticmethod
def randperm(n:int, device=None, dtype=dtypes.int32, **kwargs) -> Tensor:
"""
Returns a tensor with a random permutation of integers from `0` to `n-1`.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
print(Tensor.randperm(6).numpy())
```
"""
return Tensor.rand(n, device=device, **kwargs).argsort().cast(dtype)
def multinomial(self:Tensor, num_samples:int = 1, replacement:bool = False) -> Tensor:
"""
Returns a tensor with `num_samples` indices sampled from a multinomial distribution weighted by `self`.
NOTE: `replacement=False` for `num_samples > 1` is not supported yet.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor([1, 2, 3, 4])
print(t.multinomial(20, replacement=True).numpy())
```
"""
assert 1 <= self.ndim <= 2 and num_samples > 0, f"{self.ndim=} must be 1 or 2 dim, {num_samples=} must be positive"
assert replacement or num_samples == 1, "no replacement only supports num_samples = 1"
weight = self.unsqueeze(0) if self.ndim == 1 else self
cdf = (cw := weight.cumsum(1).float()) / cw[:, -1].unsqueeze(1)
unif_samples = Tensor.rand(num_samples, cdf.shape[0], 1).to(self.device)
indices = (unif_samples.expand((-1, -1, cdf.shape[1])) >= cdf).sum(2).permute((1, 0))
return (indices.squeeze(0) if self.ndim == 1 else indices).cast(dtypes.int32)
# ***** toposort and backward pass *****
def gradient(self, *targets:Tensor, gradient:Tensor|None=None, materialize_grads=False) -> list[Tensor]:
"""
Computes the gradient of the targets with respect to self.
```python exec="true" source="above" session="tensor" result="python"
x = Tensor.eye(3)
y = Tensor([[2.0,0,-2.0]])
z = y.matmul(x).sum()
dx, dy = z.gradient(x, y)
print(dx.tolist()) # dz/dx
print(dy.tolist()) # dz/dy
```
"""
assert gradient is not None or self.shape == tuple(), "when no gradient is provided, backward must be called on a scalar tensor"
if not (self.is_floating_point() and all(t.is_floating_point() for t in targets)): raise RuntimeError("only float Tensors have gradient")
if gradient is None: gradient = Tensor(1.0, dtype=self.dtype, device=self.device, requires_grad=False)
target_uops = [x.uop for x in targets]
grads = compute_gradient(self.uop, gradient.uop, set(target_uops))
ret = []
for x in target_uops:
if (y:=grads.get(x)) is None:
if materialize_grads: y = x.const_like(0)
else: raise RuntimeError(f"{x}\n\nnot found in\n\n{self.uop}")
ret.append(y)
# create returned Tensors
return [Tensor(u, device=t.device) for t,u in zip(targets, ret)]
def backward(self, gradient:Tensor|None=None) -> Tensor:
"""
Propagates the gradient of a tensor backwards through the computation graph.
If the 'gradient' argument is not provided, the tensor must be a scalar, and the gradient is implicitly set to 1.0.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([1.0, 2.0, 3.0, 4.0], requires_grad=True)
t.sum().backward()
print(t.grad.numpy())
```
"""
all_uops = self.uop.toposort()
tensors_need_grad: list[Tensor] = [t for tref in all_tensors if (t:=tref()) is not None and \
t.uop in all_uops and t.requires_grad]
# clear contexts
for t,g in zip(tensors_need_grad, self.gradient(*tensors_need_grad, gradient=gradient, materialize_grads=True)):
assert g.shape == t.shape, f"grad shape must match tensor shape, {g.shape!r} != {t.shape!r}"
if t.grad is None: t.grad = g
else: t.grad.assign(t.grad + g)
return self
# ***** movement low level ops *****
def _mop(self, op:Ops, arg) -> Tensor: return self._apply_uop(UOp._mop, extra_args=(op,), arg=arg)
def pad(self, padding:Sequence[sint]|Sequence[tuple[sint, sint]|None], mode:str="constant", value:float=0.0) -> Tensor:
"""
Returns a tensor with padding applied based on the input `padding`.
`padding` supports two padding structures:
1. Flat padding: `(padding_left, padding_right, padding_top, padding_bottom, ...)`
- This structure matches PyTorch's pad.
- `padding` length must be even.
2. Group padding: `(..., (padding_top, padding_bottom), (padding_left, padding_right))`
- This structure matches pad for JAX, NumPy, TensorFlow, and others.
- For each axis, padding can be `None`, meaning no padding, or a tuple `(start, end)`.
- `padding` must have the same length as `self.ndim`.
Padding values can be negative, resulting in dimension shrinks that work similarly to Python negative slices.
Padding modes is selected with `mode` which supports `constant`, `reflect` and `replicate`.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.arange(9).reshape(1, 1, 3, 3)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.pad((1, 2, 0, -1)).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.pad(((None, None, (0, -1), (1, 2)))).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.pad((1, 2, 0, -1), value=-float('inf')).numpy())
```
"""
if mode not in {"constant", "reflect", "replicate", "circular"}: raise NotImplementedError(f"{mode=} is not supported")
# flat padding
if all(isinstance(p, (int,UOp)) for p in padding):
if len(padding)%2 != 0: raise ValueError("Flat padding must have even number of pads")
pX = _flat_to_grouped(tuple(cast(Sequence[sint], padding)) + (0,0)*(self.ndim - len(padding)//2))
# group padding
else: pX = tuple((0,0) if p is None else p for p in cast(Sequence[tuple[sint, sint]|None], padding))
if len(pX) != self.ndim: raise ValueError(f"padding length is improper, {padding=} {self.ndim=}")
X, pads = self, tuple((smax(pB,0), smax(pA,0)) for pB,pA in pX)
if mode == "constant":
def _constant(x:Tensor,px,v) -> Tensor:
return x._apply_uop(UOp.pad, arg=px) if v == 0 else (x._apply_uop(UOp.pad, arg=px)+Tensor.ones_like(x)._apply_uop(UOp.pad, arg=px).where(0,v))
return _constant(X, pX, value) if all(resolve(p >= 0) for p in flatten(pX)) else \
_constant(X.shrink(tuple((-smin(pB,0),smin(pA+s,s)) for (pB,pA),s in zip(pX, X.shape))), pads, value)
assert all_int(self.shape), f"does not support symbolic shape {self.shape}"
if mode == "circular":
if any(pB>sh or pA>sh for (pB,pA),sh in zip(pX, X.shape)): raise ValueError('Padding value causes wrapping around more than once.')
if any(pB<0 or pA<0 for pB,pA in pX): raise NotImplementedError("Negative pads with circular pads is not supported")
orig_shape, X = X.shape, X.repeat(tuple(1 + bool(pB) + bool(pA) for pB,pA in pads))
return X.shrink(tuple((0 if pB == 0 else osh-pB, xsh if pA == 0 else xsh-osh+pA) for (pB,pA),osh,xsh in zip(pads, orig_shape, X.shape)))
for d,(pB,pA) in enumerate(pads):
if mode == "reflect":
if pB >= (s:=X.shape[d]) or pA>=s: raise ValueError(f"Padding ({pB}, {pA}) should be less than the input size={s} for dim={d}.")
slcB, slcA, = slice(pB,0,-1), slice(s-2 if s-2>=0 else None, s-2-pA if s-2-pA>=0 else None, -1)
xB, xA = (X[[slc if i == d else slice(None) for i in range(X.ndim)]] if p > 0 else None for slc, p in ((slcB, pB), (slcA, pA)))
if mode == "replicate":
shrB, shrA, = tuple((0,1) if i==d else None for i in range(X.ndim)), tuple((X.shape[i]-1,X.shape[i]) if i==d else None for i in range(X.ndim))
xB, xA = (X.shrink(shr).expand(tuple(p if i==d else None for i in range(X.ndim))) if p > 0 else None for shr, p in ((shrB, pB), (shrA, pA)))
X = Tensor.cat(*(X_ for X_ in (xB, X, xA) if X_ is not None), dim=d)
return X.shrink(tuple((-min(pB,0), min(pA+s,s)) for (pB,pA),s in zip(pX, X.shape)))
# convenience
def pad_to(self, shape, *args):
if len(new_shape := argfix(shape, *args)) != self.ndim: raise ValueError(f"dim mismatch, cannot pad {self.shape} to {new_shape}")
return self.pad(tuple([None if ns is None else (0, ns-s) for s,ns in zip(self.shape, new_shape)]))
# ***** movement high level ops *****
def _getitem(self, indices, v: Tensor|None = None) -> Tensor:
# wrap single index into a list
if (isinstance(indices, list) and all_int(indices)) or not isinstance(indices, (tuple, list)): indices = [indices]
x, indices = self, list(indices)
# fill ellipsis or rest of indices with slice(None)
if len(ellipsis_idx := [dim for dim, i in enumerate(indices) if i is Ellipsis]) > 1: raise IndexError("indices can only have a single ellipsis")
# NOTE: None adds a dim later
num_indices = len(indices) - len(ellipsis_idx) - sum(1 for i in indices if i is None)
if num_indices > self.ndim: raise IndexError(f"too many {num_indices=} for {self.ndim=}")
fill_idx = ellipsis_idx[0] if ellipsis_idx else len(indices)
indices[fill_idx:fill_idx+1] = [slice(None)] * (self.ndim - num_indices)
indices_parsed, dim = [], 0
for index in indices:
size = 1 if index is None else self.shape[dim]
boundary, stride = [0, size], 1 # defaults
match index:
case Tensor():
if not dtypes.is_int(index.dtype): raise IndexError(f"index dtype {index.dtype} is not supported")
assert isinstance(size, int), "size must be an int"
index = (index < 0).where(index+size, index).to(self.device) # treat negative index values
case list() | tuple():
if not dtypes.is_int((ti:=Tensor(index)).dtype): raise IndexError(f"{index=} contains non-int element")
index = Tensor([i+size if i<0 else i for i in fully_flatten(index)], self.device, requires_grad=False).reshape(ti.shape)
case int() | UOp(): # sint
if index >= size or index < -size: raise IndexError(f"{index=} is out of bounds with {size=}")
# TODO: is this right for (negative) symbolic?
boundary = [index, index+1] if index >= 0 else [index+size, index+size+1]
case slice():
if index.step == 0: raise ValueError(f"{index=} cannot have 0 as step")
start, stop = 0 if index.start is None else index.start, size if index.stop is None else index.stop
step = 1 if index.step is None else index.step
boundary, stride = [start, stop], step
if all(isinstance(s, int) for s in (start,stop,step)):
# handle int slicing
# if we're slicing a symbolic dimension into a int dimension, we can slice until the bind size
# TODO: right now this is using vmax instead of the bind size because jit doesnt update the bound value of the returned tensor
if isinstance(size, UOp): size = int(size.vmax)
*boundary, stride = index.indices(cast(SupportsIndex, size))
if stride * (boundary[1] - boundary[0]) < 0: boundary = [0, 0]
elif stride < 0: boundary = [boundary[1] + 1, boundary[0] + 1]
# update size for slice
size = ceildiv((boundary[1] - boundary[0]), abs(stride))
elif resolve(step == 1, False) and all(isinstance(s,sint) for s in (start, stop)) and resolve((stop-start) > 0, False):
# simple symbolic slice
size = cast(sint, cast(UOp, (stop - start)).ssimplify())
else: raise TypeError(f"slice {index=} is not supported")
case None: pass # do nothing
case _: raise IndexError(f"{type(index).__name__} indexing is not supported")
indices_parsed.append({"index":index, "size":size, "boundary":tuple(boundary), "stride":stride})
if index is not None: dim += 1
# movement op indexing
if mops := [i for i in indices_parsed if i['index'] is not None]:
# flip negative strides
shrinks, strides = zip(*((i['boundary'], i['stride']) for i in mops))
x = x.shrink(shrinks).flip(tuple(i for i,st in enumerate(strides) if st < 0))
strides = tuple(map(abs, strides))
# apply stride
if any(st != 1 for st in strides):
# pad shape to multiple of stride
if not all_int(x.shape): raise RuntimeError("symbolic shape not supported")
x = x.pad(tuple((0, round_up(s, st) - s) for s, st in zip(x.shape, strides)))
x = x.reshape(tuple(flatten((s // st, st) for s, st in zip(x.shape, strides))))
x = x.shrink(tuple(flatten(((0, s), (0, 1)) for s in x.shape[::2]))).reshape(x.shape[::2])
# dim injection from None by including None dim size (which is 1) and dim collapse by skipping int dim size
x = x.reshape(tuple(index['size'] for index in indices_parsed if not isinstance(index['index'], sint)))
# tensor indexing
if tops := [(d,i) for d,i in enumerate(i_ for i_ in indices_parsed if not isinstance(i_['index'], int)) if isinstance(i['index'], Tensor)]:
# unload the tensor object into actual tensors
dims, tensors, masks = [d for d,_ in tops], cast(list[Tensor], [i['index'] for _,i in tops]), []
big_shape = _broadcast_shape(*(t.shape for t in tensors))
# consecutive tensor indices with int shapes: use linear indexing instead of one-hot masks
consecutive = dims == list(range(dims[0], dims[0] + len(dims)))
if v is None and len(dims) > 1 and consecutive and all_int(ishp := tuple(x.shape[d] for d in dims)):
strides = tuple(prod(ishp[i+1:]) for i in range(len(dims)))
try: linear_idx = functools.reduce(Tensor.add, (t._broadcast_to(big_shape) * s for t, s in zip(tensors, strides)))
except ValueError as e: raise IndexError(f"cannot broadcast indices: {e}") from e
valid = functools.reduce(Tensor.__and__, ((t >= 0) & (t < s) for t, s in zip(tensors, ishp)))
pre, post = x.shape[:dims[0]], x.shape[dims[-1]+1:]
x = x.reshape(pre + (prod(ishp),) + post)[tuple([slice(None)] * len(pre)) + (valid.where(linear_idx, 0),)]
return valid.reshape((1,) * len(pre) + big_shape + (1,) * len(post)).where(x, 0)
pre_reduce_shape = x.shape[:dims[0]] + big_shape + x.shape[dims[0]:]
# create index masks
for dim, tensor in zip(dims, tensors):
try: i = tensor.reshape(tensor.shape + (1,)*(x.ndim - dims[0])).expand(pre_reduce_shape)
except ValueError as e: raise IndexError(f"cannot broadcast indices: {e}") from e
masks.append(i._one_hot_along_dim(num_classes=x.shape[dim], dim=(dim - x.ndim)))
# reduce masks to 1 mask
mask: Tensor = functools.reduce(lambda x,y: x.mul(y), masks)
# inject 1's for the extra dims added in create masks
reshape_arg = x.shape[:dims[0]] + (1,) * len(big_shape) + x.shape[dims[0]:]
# sum reduce the extra dims introduced in create masks
x = (mask.where(x.reshape(reshape_arg), 0)).sum(sum_axis:=tuple(d + len(big_shape) for d in dims), dtype=x.dtype)
# special permute case
if (permuted := dims[0] != 0 and len(dims) != 1 and tuple(dims) != tuple(range(dims[0], dims[-1]+1))):
mask, x = (y.permute(*range(dims[0], dims[0]+len(big_shape)), *range(0, dims[0]), *range(dims[0]+len(big_shape), y.ndim)) for y in (mask, x))
# for advanced setitem, returns whole tensor with indices replaced
if v is not None:
vb = v.cast(self.dtype)._broadcast_to(_broadcast_shape(x.shape, v.shape))
# add back reduced dims from sum
for dim in sum_axis: vb = vb.unsqueeze(dim)
# run _masked_setitem on tuple of axis that is to be reduced to match self.shape
x = _masked_setitem(self, vb, mask, tuple(range((start := dims[0] if not permuted else 0), start + len(big_shape))))
return x
def __getitem__(self, indices) -> Tensor:
"""
Retrieves a sub-tensor using indexing.
Supported Index Types: `int | slice | Tensor | None | list | tuple | Ellipsis`
Examples:
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.arange(12).reshape(3, 4)
print(t.numpy())
```
- Int Indexing: Select an element or sub-tensor using integers for each dimension.
```python exec="true" source="above" session="tensor" result="python"
print(t[1, 2].numpy())
```
- Slice Indexing: Select a range of elements using slice notation (`start:end:stride`).
```python exec="true" source="above" session="tensor" result="python"
print(t[0:2, ::2].numpy())
```
- Tensor Indexing: Use another tensor as indices for advanced indexing. Using `tuple` or `list` here also works.
```python exec="true" source="above" session="tensor" result="python"
print(t[Tensor([2, 0, 1]), Tensor([1, 2, 3])].numpy())
```
- `None` Indexing: Add a new dimension to the tensor.
```python exec="true" source="above" session="tensor" result="python"
print(t[:, None].shape)
```
NOTE: Out-of-bounds indexing results in a value of `0`.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([1, 2, 3])
print(t[Tensor([4, 3, 2])].numpy())
```
"""
return self._getitem(indices)
def __setitem__(self, indices, v:Tensor|PyConst|list|tuple) -> None:
if isinstance(v, Tensor) and v.dtype != self.dtype: raise RuntimeError(f"setitem dtype mismatch: {self.dtype=} != {v.dtype=}")
if self.requires_grad or (isinstance(v, Tensor) and v.requires_grad): raise NotImplementedError("setitem with requires_grad is not supported")
idx = [indices] if (isinstance(indices, list) and all_int(indices)) or not isinstance(indices, (tuple, list)) else list(indices)
is_disk = isinstance(self.device, str) and self.device.startswith("DISK")
if any(isinstance(i, (Tensor, list, tuple)) for i in idx): # advanced setitem
if is_disk: raise RuntimeError("advanced setitem is not supported for DISK tensors")
if not isinstance(v, Tensor): v = Tensor(v, device=self.device, dtype=self.dtype)
self.assign(self._getitem(indices, v))
else: # basic setitem
if is_disk: self[indices].assign(v)
else:
self[indices].assign(v).realize()
def __delitem__(self, indices) -> None:
raise TypeError("Tensor does not support deleting items")
def gather(self:Tensor, dim:int, index:Tensor) -> Tensor:
"""
Gathers values along an axis specified by `dim`.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[1, 2], [3, 4]])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.gather(1, Tensor([[0, 0], [1, 0]])).numpy())
```
"""
assert index.ndim == self.ndim, f"self.ndim must equal index.ndim, {self.ndim=}, {index.ndim=}"
dim = self._resolve_dim(dim)
assert all(s >= i for d,(s,i) in enumerate(zip(self.shape, index.shape)) if d != dim), "requires self.shape[d] >= index.shape[d] for all d != dim"
index = index.to(self.device)
x = self.shrink(tuple((0, i) if d != dim else None for d,i in enumerate(index.shape))).unsqueeze(-1).transpose(-1, dim)
return (index.unsqueeze(-1)._one_hot_along_dim(self.shape[dim]).where(x, 0)).sum(-1, dtype=self.dtype)
def cat(self:Tensor, *args:Tensor, dim:int=0) -> Tensor:
"""
Concatenates self with other `Tensor` in `args` along an axis specified by `dim`.
All tensors must have the same shape except in the concatenating dimension.
```python exec="true" source="above" session="tensor" result="python"
t0, t1, t2 = Tensor([[1, 2]]), Tensor([[3, 4]]), Tensor([[5, 6]])
print(t0.cat(t1, t2, dim=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t0.cat(t1, t2, dim=1).numpy())
```
"""
dim = self._resolve_dim(dim)
for arg in args: assert arg.ndim==self.ndim and all(ti==ai for i,(ti,ai) in enumerate(zip(self.shape, arg.shape)) if i!=dim)
tensors = [self, *args]
dim_cumsum = list(itertools.accumulate([t.shape[dim] for t in tensors], initial=0))
for i,t in enumerate(tensors): tensors[i] = t.pad([(dim_cumsum[i], dim_cumsum[-1]-dim_cumsum[i+1]) if j==dim else None for j in range(t.ndim)])
return functools.reduce(Tensor.add, tensors)
def stack(self:Tensor, *args:Tensor, dim:int=0) -> Tensor:
"""
Concatenates self with other `Tensor` in `args` along a new dimension specified by `dim`.
```python exec="true" source="above" session="tensor" result="python"
t0, t1, t2 = Tensor([1, 2]), Tensor([3, 4]), Tensor([5, 6])
print(t0.stack(t1, t2, dim=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t0.stack(t1, t2, dim=1).numpy())
```
"""
# checks for shapes and number of dimensions delegated to cat
return Tensor.cat(*[t.unsqueeze(dim) for t in argfix(self, *args)], dim=dim)
def split(self, sizes:int|Sequence[int], dim:int=0) -> tuple[Tensor, ...]:
"""
Splits the tensor into chunks along the dimension specified by `dim`.
If `sizes` is an integer, it splits into equally sized chunks if possible, otherwise the last chunk will be smaller.
If `sizes` is a list, it splits into `len(sizes)` chunks with size in `dim` according to `size`.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.arange(10).reshape(5, 2)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
split = t.split(2)
print("\\n".join([repr(x.numpy()) for x in split]))
```
```python exec="true" source="above" session="tensor" result="python"
split = t.split([1, 4])
print("\\n".join([repr(x.numpy()) for x in split]))
```
"""
dim = self._resolve_dim(dim)
dim_sz = self.shape[dim]
assert isinstance(dim_sz, int), f"does not support symbolic shape in split dimension {dim}: {self.shape}"
if isinstance(sizes, int): sizes = [min(sizes, dim_sz-i) for i in range(0, max(1, dim_sz), max(1, sizes))]
assert sum(sizes) == dim_sz, f"expect sizes to sum exactly to {dim_sz}, but got {sum(sizes)}"
return tuple(self[sl] for sl in [tuple([slice(None)]*dim + [slice(sum(sizes[:i]), sum(sizes[:i + 1]))]) for i in range(len(sizes))])
def chunk(self, chunks:int, dim:int=0) -> list[Tensor]:
"""
Splits the tensor into `chunks` number of chunks along the dimension `dim`.
If the tensor size along `dim` is not divisible by `chunks`, all returned chunks will be the same size except the last one.
The function may return fewer than the specified number of chunks.
```python exec="true" source="above" session="tensor" result="python"
chunked = Tensor.arange(11).chunk(6)
print("\\n".join([repr(x.numpy()) for x in chunked]))
```
```python exec="true" source="above" session="tensor" result="python"
chunked = Tensor.arange(12).chunk(6)
print("\\n".join([repr(x.numpy()) for x in chunked]))
```
```python exec="true" source="above" session="tensor" result="python"
chunked = Tensor.arange(13).chunk(6)
print("\\n".join([repr(x.numpy()) for x in chunked]))
```
"""
dim = self._resolve_dim(dim)
dim_sz = self.shape[dim]
assert isinstance(dim_sz, int), f"does not support symbolic shape in split dimension {dim}: {self.shape}"
assert chunks > 0, f"expect chunks to be greater than 0, got: {chunks}"
return list(self.split(ceildiv(dim_sz, chunks) if dim_sz else [0]*chunks, dim=dim))
def unfold(self, dim:int, size:sint, step:int) -> Tensor:
"""
Unfolds the tensor along dimension `dim` into overlapping windows.
Each window has length `size` and begins every `step` elements of `self`.
Returns the input tensor with dimension `dim` replaced by dims `(n_windows, size)`
where `n_windows = (self.shape[dim] - size) // step + 1`.
```python exec="true" source="above" session="tensor" result="python"
unfolded = Tensor.arange(8).unfold(0,2,2)
print("\\n".join([repr(x.numpy()) for x in unfolded]))
```
```python exec="true" source="above" session="tensor" result="python"
unfolded = Tensor.arange(27).reshape(3,3,3).unfold(-1,2,3)
print("\\n".join([repr(x.numpy()) for x in unfolded]))
```
"""
if size < 0: raise RuntimeError(f'size must be >= 0 but got {size=}')
if step <= 0: raise RuntimeError(f'step must be > 0 but got {step=}')
if size > self.shape[dim]: raise RuntimeError(f'maximum size for tensor at dimension {dim} is {self.shape[dim]} but size is {size}')
dim = self._resolve_dim(dim)
perm_to_last = tuple(i for i in range(self.ndim) if i != dim) + (dim,)
return self.permute(perm_to_last)._pool((size,), step).permute(argsort(perm_to_last) + (self.ndim,))
def meshgrid(self:Tensor, *args:Tensor, indexing:str="ij") -> tuple[Tensor, ...]:
"""
Generates coordinate matrices from coordinate vectors.
Input tensors can be scalars or 1D tensors.
`indexing` determines how the output grids are aligned.
`ij` indexing follows matrix-style indexing and `xy` indexing follows Cartesian-style indexing.
```python exec="true" source="above" session="tensor" result="python"
x, y = Tensor([1, 2, 3]), Tensor([4, 5, 6])
grid_x, grid_y = x.meshgrid(y)
print(grid_x.numpy())
print(grid_y.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
grid_x, grid_y = x.meshgrid(y, indexing="xy")
print(grid_x.numpy())
print(grid_y.numpy())
```
"""
if indexing not in ("ij", "xy"): raise RuntimeError(f'indexing must be in ("ij", "xy"), got {indexing}')
if len(tensors:=(self, *args)) == 1: return tensors
basis = tuple(range(len(tensors))) if indexing == "ij" else (1, 0) + tuple(range(2, len(tensors)))
tensors = tuple(t.reshape((-1,) + (1,)*(len(args) - i)) for i,t in zip(basis, tensors))
output_shape = _broadcast_shape(*(t.shape for t in tensors))
return tuple(t._broadcast_to(output_shape) for t in tensors)
def diag(self) -> Tensor:
"""
Returns a 2-D square tensor with the elements of input as the main diagonal.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([1, 2, 3]).diag().numpy())
```
"""
if self.ndim != 1: raise ValueError(f"expect input to be 1-D, getting {self.ndim}-D")
return self.unsqueeze(-1).pad((None,(0,n:=self.shape[0]))).flatten().shrink(((0,n*n),)).reshape(n,n)
def diagonal(self, offset:int=0, dim1:int=0, dim2:int=1) -> Tensor:
"""
Returns a view of the diagonal elements with respect to `dim1` and `dim2`.
`offset` controls which diagonal: 0 is main, positive is above, negative is below.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.arange(9).reshape(3, 3)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.diagonal().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.diagonal(offset=1).numpy())
```
"""
if (dim1:=self._resolve_dim(dim1)) == (dim2:=self._resolve_dim(dim2)): raise RuntimeError("dim1 and dim2 cannot be the same dimension")
x = self.permute(*[i for i in range(self.ndim) if i != dim1 and i != dim2], dim1, dim2)
x = x[..., :, offset:] if offset >= 0 else x[..., -offset:, :]
if (d := min(int(x.shape[-2]), int(x.shape[-1]))) <= 0: return x.reshape(*x.shape[:-2], 0)
return x[..., :d, :d].flatten(-2).pad(tuple((0,0) for _ in x.shape[:-2])+((0,d),)).reshape(*x.shape[:-2], d, d+1)[..., 0]
def roll(self, shifts:int|tuple[int, ...], dims:int|tuple[int, ...]|None=None) -> Tensor:
"""
Rolls the tensor along specified dimension(s).
The rolling operation is circular, meaning that elements that go beyond the edge are wrapped around to the beginning of the dimension.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.arange(4)
print(t.roll(shifts=1, dims=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.roll(shifts=-1, dims=0).numpy())
```
"""
if dims is None: return self.flatten().roll(shifts, 0).reshape(self.shape)
dims, shifts, slices = tuple(self._resolve_dim(d) for d in make_tuple(dims, 1)), make_tuple(shifts, 1), [slice(None)] * self.ndim
if len(dims) != len(shifts): raise RuntimeError(f"{len(dims)=} != {len(shifts)=}")
for dim, shift in zip(dims, shifts): slices[dim] = slice(delta:=self.shape[dim]-shift%self.shape[dim], delta+self.shape[dim])
return self.repeat(*tuple(2 if i in dims else 1 for i in range(self.ndim)))[slices]
def masked_select(self, mask):
"""
Selects elements from `self` based on the boolean `mask`.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[0, 1, 2], [3, 4, 5], [6, 7, 8]])
mask = Tensor([[True, False, True], [False, True, False], [False, False, True]])
print(t.numpy())
print(mask.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.masked_select(mask).numpy())
```
"""
if not dtypes.is_bool(mask.dtype): raise RuntimeError(f"masked_select expects bool mask tensor, got {mask.dtype}")
x, mask = self.flatten(), mask._broadcast_to(self.shape).flatten()
mask_cumsum = mask.cumsum()
counts = Tensor.zeros(mask_cumsum[-1].item(), dtype=dtypes.int32)
idxs = counts.scatter(0, mask_cumsum, 1, reduce='add').cumsum()
return x[idxs]
def nonzero(self) -> Tensor:
"""
Returns the indices of the elements that are non-zero.
Returns a 2D tensor where each row is the index of a non-zero element.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([1, 0, 2, 0, 3])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.nonzero().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[1, 0], [0, 2]])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.nonzero().numpy())
```
"""
mask = (self != 0).flatten()
indices = Tensor.stack(*[Tensor.arange(s, device=self.device).reshape(*[1]*i, s, *[1]*(self.ndim-i-1)).expand(self.shape).flatten()
for i, s in enumerate(self.shape)], dim=-1)
return indices.masked_select(mask.unsqueeze(-1).expand(*mask.shape, self.ndim)).reshape(-1, self.ndim)
def masked_fill(self:Tensor, mask:Tensor, value:Tensor|PyConst) -> Tensor:
"""
Replaces `self` with `value` wherever the elements of `mask` are True.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([1, 2, 3, 4, 5])
mask = Tensor([True, False, True, False, False])
print(t.masked_fill(mask, -12).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([1, 2, 3, 4, 5])
mask = Tensor([True, False, True, False, False])
value = Tensor([-1, -2, -3, -4, -5])
print(t.masked_fill(mask, value).numpy())
```
"""
return mask.where(value, self)
# ***** reduce ops *****
def _reduce(self, op:Ops, axis:int|Sequence[int]|None=None, keepdim=False) -> Tensor:
axis = tuple(self._resolve_dim(x) for x in (range(self.ndim) if axis is None else make_tuple(axis, 1)))
if self.ndim == 0: axis = ()
ret = self._apply_uop(UOp.r, op=op, axis=axis)
return ret if keepdim else ret.reshape(tuple(s for i,s in enumerate(self.shape) if i not in axis))
def sum(self, axis:int|Sequence[int]|None=None, keepdim=False, dtype:DTypeLike|None=None) -> Tensor:
"""
Returns the sum of the elements of the tensor along the specified axis or axes.
You can pass in `axis` and `keepdim` keyword arguments to control the axis along
which the maximum is computed and whether the reduced dimensions are retained.
You can pass in `dtype` keyword argument to control the data type of the accumulation.
If not specified, the accumulation data type is chosen based on the input tensor's data type.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.arange(6).reshape(2, 3)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.sum().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.sum(axis=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.sum(axis=1).numpy())
```
"""
ret = self.cast(sum_acc_dtype(self.dtype) if dtype is None else dtype)._reduce(Ops.ADD, axis, keepdim)
return ret.cast(self.dtype) if dtype is None and self.dtype in (dtypes.float16, dtypes.bfloat16, *dtypes.fp8s) else ret
def prod(self, axis:int|Sequence[int]|None=None, keepdim=False, dtype:DTypeLike|None=None) -> Tensor:
"""
Returns the product of the elements of the tensor along the specified axis or axes.
You can pass in `axis` and `keepdim` keyword arguments to control the axis along
which the maximum is computed and whether the reduced dimensions are retained.
You can pass in `dtype` keyword argument to control the data type of the accumulation.
If not specified, the accumulation data type is chosen based on the input tensor's data type.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([-1, -2, -3, 1, 2, 3]).reshape(2, 3)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.prod().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.prod(axis=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.prod(axis=1).numpy())
```
"""
return self.cast(dtype if dtype is not None else self.dtype)._reduce(Ops.MUL, axis, keepdim)
def max(self, axis:int|Sequence[int]|None=None, keepdim=False) -> Tensor:
"""
Returns the maximum value of the tensor along the specified axis or axes.
You can pass in `axis` and `keepdim` keyword arguments to control the axis along
which the maximum is computed and whether the reduced dimensions are retained.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[1, 0, 2], [5, 4, 3]])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.max().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.max(axis=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.max(axis=1, keepdim=True).numpy())
```
"""
return self._reduce(Ops.MAX, axis, keepdim)
def _inverse(self) -> Tensor: return -self if self.is_floating_point() else ~self if dtypes.is_int(self.dtype) else self.logical_not()
def min(self, axis:int|Sequence[int]|None=None, keepdim=False) -> Tensor:
"""
Returns the minimum value of the tensor along the specified axis or axes.
You can pass in `axis` and `keepdim` keyword arguments to control the axis along
which the minimum is computed and whether the reduced dimensions are retained.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[1, 0, 2], [5, 4, 3]])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.min().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.min(axis=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.min(axis=1, keepdim=True).numpy())
```
"""
return self._inverse().max(axis=axis, keepdim=keepdim)._inverse()
def any(self, axis:int|Sequence[int]|None=None, keepdim=False) -> Tensor:
"""
Tests if any element evaluates to `True` along the specified axis or axes.
You can pass in `axis` and `keepdim` keyword arguments to control the reduce axis and whether the reduced dimensions are retained.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[True, True], [True, False], [False, False]])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.any().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.any(axis=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.any(axis=1, keepdim=True).numpy())
```
"""
return self.bool().max(axis, keepdim)
def all(self, axis:int|Sequence[int]|None=None, keepdim=False) -> Tensor:
"""
Tests if all element evaluates to `True` along the specified axis or axes.
You can pass in `axis` and `keepdim` keyword arguments to control the reduce axis and whether the reduced dimensions are retained.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[True, True], [True, False], [False, False]])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.all().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.all(axis=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.all(axis=1, keepdim=True).numpy())
```
"""
return self.logical_not().any(axis, keepdim).logical_not()
def isclose(self, other:Tensor, rtol:float=1e-05, atol:float=1e-08, equal_nan=False) -> Tensor:
"""
Returns a new tensor with element-wise comparison of closeness to `other` within a tolerance.
The `rtol` and `atol` keyword arguments control the relative and absolute tolerance of the comparison.
By default, two `NaN` values are not close to each other. If `equal_nan` is `True`, two `NaN` values are considered close.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([1e-7, 1e-8, 1e-9, float('nan')]).isclose(Tensor([0.0, 0.0, 0.0, float('nan')])).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([float('nan')]).isclose(Tensor([float('nan')]), equal_nan=True).numpy())
```
"""
is_finite_close = self.isfinite() & other.isfinite() & ((self - other).abs() <= atol + rtol * other.abs())
is_infinite_close = (self.isinf() | other.isinf()) & (self == other)
is_nan_close = (self.isnan() & other.isnan()) & equal_nan
return is_finite_close | is_infinite_close | is_nan_close
def allclose(self, other:Tensor, rtol:float=1e-05, atol:float=1e-08, equal_nan=False) -> bool:
"""
Check if all self and other are close. Return True or False.
"""
return bool(self.isclose(other, rtol=rtol, atol=atol, equal_nan=equal_nan).all().item())
def mean(self, axis:int|Sequence[int]|None=None, keepdim=False) -> Tensor:
"""
Returns the mean value of the tensor along the specified axis or axes.
You can pass in `axis` and `keepdim` keyword arguments to control the axis along
which the mean is computed and whether the reduced dimensions are retained.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor.normal(2, 3, mean=2.5, std=0.5)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.mean().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.mean(axis=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.mean(axis=1).numpy())
```
"""
output_dtype = self.dtype if dtypes.is_float(self.dtype) else dtypes.float32
numerator = self.cast(sum_acc_dtype(self.dtype)).sum(axis=axis, keepdim=keepdim)
denominator = prod([si for si, so in zip(self.shape, self.sum(axis=axis, keepdim=True).shape) if resolve(si != so)])
return numerator.div(Tensor.from_uop(denominator, device=numerator.device) if isinstance(denominator, UOp) else denominator).cast(output_dtype)
def var(self, axis:int|Sequence[int]|None=None, keepdim=False, correction=1) -> Tensor:
"""
Returns the variance of the tensor along the specified axis or axes.
You can pass in `axis`, `keepdim`, and `correction` keyword arguments to control the axis along
which the variance is computed, whether the reduced dimensions are retained, and the Bessel's correction applied.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor.normal(2, 3, mean=2.5, std=0.5)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.var().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.var(axis=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.var(axis=1).numpy())
```
"""
squares = (self - self.mean(axis=axis, keepdim=True)).square()
n = prod([si for si, so in zip(self.shape, squares.sum(axis=axis, keepdim=True).shape) if resolve(si != so)])
denominator = (Tensor.from_uop(n, device=self.device) if isinstance(n, UOp) else Tensor(n, device=self.device)) - correction
return squares.sum(axis=axis, keepdim=keepdim).div(denominator.relu())
def var_mean(self, axis:int|Sequence[int]|None=None, keepdim=False, correction=1) -> tuple[Tensor, Tensor]:
"""
Calculates the variance and mean over the dimensions specified by dim.
Syntactic sugar around `Tensor.var` and `Tensor.mean` to match `torch.var_mean`.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor.normal(2, 3, mean=2.5, std=0.5)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
var, mean = t.var_mean()
print(var.numpy(), mean.numpy())
```
"""
return self.var(axis, keepdim, correction), self.mean(axis, keepdim)
def std(self, axis:int|Sequence[int]|None=None, keepdim=False, correction=1) -> Tensor:
"""
Returns the standard deviation of the tensor along the specified axis or axes.
You can pass in `axis`, `keepdim`, and `correction` keyword arguments to control the axis along
which the standard deviation is computed, whether the reduced dimensions are retained, and the Bessel's correction applied.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor.normal(2, 3, mean=2.5, std=0.5)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.std().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.std(axis=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.std(axis=1).numpy())
```
"""
return self.var(axis, keepdim, correction).sqrt()
def std_mean(self, axis:int|Sequence[int]|None=None, keepdim=False, correction=1) -> tuple[Tensor, Tensor]:
"""
Calculates the standard deviation and mean over the dimensions specified by dim.
Syntactic sugar around `Tensor.std` and `Tensor.mean` to match `torch.std_mean`.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor.normal(2, 3, mean=2.5, std=0.5)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
std, mean = t.std_mean()
print(std.numpy(), mean.numpy())
```
"""
return self.std(axis, keepdim, correction), self.mean(axis, keepdim)
def keccak(self, cfg:str|tuple[int, int]="sha3_256"):
"""
Calculates a Keccak hash over the last dimension. Uses "sha3_256" by default.
```python exec="false" source="above" session="tensor" result="python"
t = Tensor(b"Hello World!").keccak()
print(t.data().hex())
```
"""
# https://keccak.team/keccak_specs_summary.html
def ctensor(l: Sequence[PyConst], dtype: DType = dtypes.uint64):
# TODO: contiguous is here for compile speed
return Tensor.stack(*(Tensor(v, dtype=dtype, device=self.device) for v in l)).contiguous()
rot_offsets = [44, 43, 21, 14, 28, 20, 3, 45, 61, 1, 6, 25, 8, 18, 27, 36, 10, 15, 56, 62, 55, 39, 41, 2]
rot_offsets_v0, rot_offsets_v1 = ctensor([0] + [1 << v for v in rot_offsets]), ctensor([1] + [1 << (64 - v) for v in rot_offsets])
# calculated from π step
reorder_indexes = ctensor([0,6,12,18,24,3,9,10,16,22,1,7,13,19,20,4,5,11,17,23,2,8,14,15,21], dtype=dtypes.int32)
rnd_const_masks = [ctensor([v]).pad((0, 24)) for v in (1, 0x8082, 0x800000000000808a, 0x8000000080008000, 0x808b, 0x80000001, 0x8000000080008081,
0x8000000000008009, 0x8a, 0x88, 0x80008009, 0x8000000a, 0x8000808b, 0x800000000000008b, 0x8000000000008089, 0x8000000000008003,
0x8000000000008002, 0x8000000000000080, 0x800a, 0x800000008000000a, 0x8000000080008081, 0x8000000000008080, 0x80000001, 0x8000000080008008)]
rate, dsbyte = {"sha3_224": (144, 6), "sha3_256": (136, 6), "shake_128": (168, 31)}[cfg] if isinstance(cfg, str) else cfg
data, data_pad = self.bitcast(dtypes.uint8).reshape(prod(self.shape[:-1]), self.shape[-1]), rate - (self.shape[-1] * self.dtype.itemsize % rate)
# pad batches then pad blocks
data = data.pad((None, (0, data_pad))).reshape(bs := data.shape[0], -1, rate).pad((None, None, (0, 200 - rate)))
# create pad mask
lbe = prod(data.shape[1:]) + rate - data_pad - 200
if data_pad == 1: mb = [(lbe, 0), (1, dsbyte ^ 0x80), (200 - rate, 0)]
else: mb = [(lbe, 0), (1, dsbyte), (data_pad - 2, 0), (1, 0x80), (200 - rate, 0)]
pad_mask = Tensor.cat(*(Tensor(v, dtype=dtypes.uint8, device=data.device).expand(l) for l, v in mb if l > 0)).unsqueeze(0)
data = (data.flatten(1) ^ pad_mask).reshape(*data.shape[:2], 200).bitcast(dtypes.uint64)
state = Tensor.zeros(bs, 25, device=self.device, dtype=dtypes.uint64)
for k in range(int(data.shape[1])):
state = state ^ data.shrink((None, (k, k+1), None)).squeeze(1)
for i in range(24): # f1600
# θ step
p = state.reshape(bs, 5, 5).transpose(2, 1)
t1 = (p[:,:,0] ^ p[:,:,1] ^ p[:,:,2] ^ p[:,:,3] ^ p[:,:,4]).roll(-1, 1) # xor reduce
state = state ^ (t1.roll(2, 1).bitwise_xor((t1 << 1) ^ (t1 >> 63)).unsqueeze(2).expand(bs, 5, 5).transpose(2, 1).flatten(1))
# ρ and π steps
state = state[:, reorder_indexes]
state = (state * rot_offsets_v0).bitwise_or(state // rot_offsets_v1).reshape(bs, 5, 5)
# χ and ι step
state = state.bitwise_xor(~state.roll(shifts=-1, dims=2) & state.roll(shifts=-2, dims=2))
state = state.flatten(1) ^ rnd_const_masks[i]
# NOTE: there was a kernelize here to prevent internal stack from growing propotional to data size, do we need something else?
return state.bitcast(dtypes.uint8)[:,:(obytes:=(200 - rate) // 2)].reshape(*self.shape[:-1], obytes)
def _hash_1mb(self) -> Tensor:
assert self.dtype == dtypes.uint8, "only support uint8 tensors for hashing"
assert self.ndim == 2, "only support batched 1d tensors"
assert self.shape[1] == 1024 * 1024, "only support messages of 1mb"
blocks = self.shape[0] * self.shape[1] // 4096
data = self.reshape(blocks, 4096)
block_hashes = data.keccak("shake_128").reshape(self.shape[0], 4096)
return block_hashes.keccak("shake_128").reshape(self.shape[0], 16)
def hash(self) -> Tensor:
"""
Calculates a 16-byte hash of the tensor.
```python exec="false source="above" session="tensor" result="python"
t = Tensor(b"Hello World!").hash()
print(t.data().hex())
```
"""
data = self.flatten().bitcast(dtypes.uint8)
if (tsize := data.shape[0]) % 2**20 != 0: data = data.pad((0, 2**20 - tsize % 2**20))
base_chunks = ceildiv(data.shape[0], 2**20)
tree_depth = math.ceil(math.log(base_chunks, 65536)) if base_chunks > 1 else 0
level_chunks = base_chunks
for _ in range(tree_depth + 1):
data = data.reshape(level_chunks, 2**20)._hash_1mb().flatten()
if (tsize := data.shape[0]) % 2**20 != 0: data = data.pad((0, 2**20 - tsize % 2**20))
level_chunks = ceildiv(data.shape[0], 2**20)
return data[:16]
def _softmax(self, axis, dtype:DTypeLike|None=None) -> tuple[Tensor, Tensor, Tensor]:
m = self - self.max(axis=axis, keepdim=True).detach()
if dtype is not None: m = m.cast(dtype)
e = m.exp()
return m, e, e.sum(axis=axis, keepdim=True)
def softmax(self, axis=-1, dtype:DTypeLike|None=None) -> Tensor:
"""
Applies the softmax function to the tensor along the specified axis.
Rescales the elements of the tensor such that they lie in the range [0, 1] and sum to 1.
You can pass in the `axis` keyword argument to control the axis along which the softmax is computed.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor.randn(2, 3)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.softmax().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.softmax(axis=0).numpy())
```
"""
_, e, ss = self._softmax(axis, dtype)
return e.div(ss)
def log_softmax(self, axis=-1, dtype:DTypeLike|None=None) -> Tensor:
"""
Applies the log-softmax function to the tensor along the specified axis.
The log-softmax function is a numerically stable alternative to the softmax function in log space.
You can pass in the `axis` keyword argument to control the axis along which the log-softmax is computed.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor.randn(2, 3)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.log_softmax().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.log_softmax(axis=0).numpy())
```
"""
m, _, ss = self._softmax(axis, dtype)
return m - ss.log()
def logsumexp(self, axis=None, keepdim=False) -> Tensor:
"""
Computes the log-sum-exp of the tensor along the specified axis or axes.
The log-sum-exp function is a numerically stable way to compute the logarithm of the sum of exponentials.
You can pass in `axis` and `keepdim` keyword arguments to control the axis along
which the log-sum-exp is computed and whether the reduced dimensions are retained.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor.randn(2, 3)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.logsumexp().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.logsumexp(axis=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.logsumexp(axis=1).numpy())
```
"""
m = self.max(axis=axis, keepdim=True)
return (self - m).exp().sum(axis=axis, keepdim=keepdim).log() + (m if keepdim else m.squeeze(axis))
def logcumsumexp(self, axis=0) -> Tensor:
"""
Computes the log-cumsum-exp of the tensor along the specified axis or axes.
The log-cumsum-exp function is a numerically stable way to compute the logarithm of the cumulative sum of exponentials.
You can pass in the `axis` keyword argument to control the axis along which
the log-cumsum-exp is computed.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor.randn(2, 3)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.logcumsumexp().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.logcumsumexp(axis=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.logcumsumexp(axis=1).numpy())
```
"""
if self.ndim == 0: return self
x = self.transpose(axis, -1)
last_dim_size = x.shape[-1]
x_unsqueezed = x.unsqueeze(-2).expand((None,)*(self.ndim-1)+(last_dim_size, None))
x_cummax, _ = x.cummax(-1)
mask = Tensor.ones(last_dim_size, last_dim_size, requires_grad=False, device=self.device).tril()
ret = mask.where(x_unsqueezed - x_cummax.unsqueeze(-1), dtypes.min(self.dtype)).exp().sum(-1).log() + x_cummax
return ret.transpose(-1, axis)
def argmax(self, axis=None, keepdim=False) -> Tensor:
"""
Returns the indices of the maximum value of the tensor along the specified axis.
You can pass in `axis` and `keepdim` keyword arguments to control the axis along
which the maximum is computed and whether the reduced dimensions are retained.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[1, 0, 2], [5, 4, 3]])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.argmax().numpy()) # Returns the index of the maximum value in the flattened tensor.
```
```python exec="true" source="above" session="tensor" result="python"
print(t.argmax(axis=0).numpy()) # Returns the indices of the maximum values along axis 0.
```
```python exec="true" source="above" session="tensor" result="python"
print(t.argmax(axis=1).numpy()) # Returns the indices of the maximum values along axis 1.
```
"""
if axis is None: return self.flatten().argmax(0)
axis = self._resolve_dim(axis)
m = self == self.max(axis=axis, keepdim=True)
idx = m * Tensor.arange(self.shape[axis],0,-1, requires_grad=False, device=self.device).reshape(self.shape[axis], *[1]*(self.ndim-axis-1))
return (self.shape[axis]-idx.max(axis=axis, keepdim=keepdim)).cast(dtypes.int32)
def argmin(self, axis=None, keepdim=False) -> Tensor:
"""
Returns the indices of the minimum value of the tensor along the specified axis.
You can pass in `axis` and `keepdim` keyword arguments to control the axis along
which the minimum is computed and whether the reduced dimensions are retained.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[1, 0, 2], [5, 4, 3]])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.argmin().numpy()) # Returns the index of the minimum value in the flattened tensor.
```
```python exec="true" source="above" session="tensor" result="python"
print(t.argmin(axis=0).numpy()) # Returns the indices of the minimum values along axis 0.
```
```python exec="true" source="above" session="tensor" result="python"
print(t.argmin(axis=1).numpy()) # Returns the indices of the minimum values along axis 1.
```
"""
return self._inverse().argmax(axis=axis, keepdim=keepdim)
@staticmethod
def einsum(formula:str, *operands:Tensor|Sequence[Tensor], dtype:DTypeLike|None=None) -> Tensor:
"""
Sums the product of the elements of the input tensors according to a formula based on the Einstein summation convention.
See: https://pytorch.org/docs/stable/generated/torch.einsum.html
```python exec="true" source="above" session="tensor" result="python"
x = Tensor([[1, 2], [3, 4]])
y = Tensor([[5, 6], [7, 8]])
print(Tensor.einsum("ij,ij->", x, y).numpy())
```
"""
xs, formula = list(argfix(*operands)), formula.replace(" ", "")
# expand ellipsis to letters, determine output
if "..." in formula:
ell, lhs = "".join(c for c in string.ascii_letters if c not in formula), (formula.split("->") + [""])[0]
ell_n = [max(0, x.ndim - len(s) + 3) if "..." in s else 0 for s, x in zip(lhs.split(","), xs)]
for i, (s, x) in enumerate(zip(inputs := lhs.split(","), xs)): inputs[i] = s.replace("...", ell[max(ell_n)-ell_n[i]:max(ell_n)])
lhs, auto = ",".join(inputs), "".join(sorted(c for c in lhs if lhs.count(c) == 1 and c.isalpha() and c not in ell))
formula = f"{lhs}->{formula.split('->')[1].replace('...', ell[:max(ell_n)]) if '->' in formula else ell[:max(ell_n)] + auto}"
lhs, rhs = formula.split("->") if "->" in formula else (formula, "".join(sorted(c for c in formula if formula.count(c)==1 and c.isalpha())))
inputs = lhs.split(",")
if len(xs) != len(inputs): raise ValueError(f"number of operands doesn't match, expected {len(inputs)}, got {len(xs)}")
# trace: take diagonal when letter repeats in single input
for i, (s, x) in enumerate(zip(inputs, xs)):
for c in set(s):
while s.count(c) > 1:
j, k, n = s.index(c), s.index(c, s.index(c)+1), cast(int, x.shape[s.index(c)])
perm = [d for d in range(x.ndim) if d not in (j,k)]+[j,k]
x = x.permute(perm).flatten(-2).pad(((0,0),)*(x.ndim-2)+((0,n),)).unflatten(-1,(n,n+1))[...,0] if x.ndim > 2 else x.diagonal()
s = s[:k] + s[k+1:]
inputs[i], xs[i] = s, x
# check sizes and build sorted alphabet
sz = merge_dicts([dict(zip(s, x.shape)) for s, x in zip(inputs, xs)])
alpha = sorted(sz)
# align all tensors to alphabet, multiply, sum non-output, permute to output order
xs = [x.permute(*[s.index(c) for c in sorted(s)]).reshape([sz[c] if c in s else 1 for c in alpha]).expand([sz[c] for c in alpha]) if s else x
for s, x in zip(inputs, xs)]
return functools.reduce(lambda a,b:a*b, xs).sum([i for i,c in enumerate(alpha) if c not in rhs], dtype=dtype).permute(argsort(argsort(list(rhs))))
# ***** processing ops *****
def _resolve_pool_pads(self, padding:int|Sequence[int], dims:int) -> Sequence[int]:
if not isinstance(padding, int) and not (len(padding) == 2*dims or len(padding) == dims):
raise ValueError(f"Padding must be an int or a sequence of length {dims} or {2*dims}, but got {padding=} for {self.shape=} with {dims=}.")
return [padding]*2*dims if isinstance(padding, int) else (padding if len(padding) == 2*dims else [p for p in padding for _ in range(2)][::-1])
def _apply_ceil_mode(self, pads:Sequence[int], k_:tuple[sint, ...], s_:int|tuple[int, ...], d_:int|tuple[int, ...]) -> list[int]:
(d_,s_), i_ = (make_tuple(x, len(k_)) for x in (d_,s_)), self.shape[-len(k_):]
pads, grouped_pads = list(pads), _flat_to_grouped(pads)
# https://arxiv.org/pdf/1603.07285 section 5.1, relationship 15.
o_ = [ceildiv(i+pB+pA - (d*(k-1)+1), s) + 1 for i,d,k,s,(pB,pA) in zip(i_,d_,k_,s_,grouped_pads)]
for dim,(o,i,s,k,d,(pB,pA)) in enumerate(zip(o_,i_,s_,k_,d_,grouped_pads)):
# we have to do additional padding before `_pool` so that `o_` in `_pool` is calculated correctly
# `s*(o-1) + (d*(k-1)+1) - (i+pB+pA)` -> last_sliding_window_start + full_kernel_size - padded_input_shape
# we decrease padding in the case that a sliding window starts in the end padded region, thereby decreasing `o_` in `_pool`
# `smax(s*(o-1) - (pB+i-1), 0)` -> last_sliding_window_start - (pad_before + input_size - zero_offset)
pads[-1-dim*2] += s*(o-1) + (d*(k-1)+1) - (i+pB+pA) - smax(s*(o-1) - (pB+i-1), 0)
return pads
# NOTE: these work for more than 2D
def avg_pool2d(self, kernel_size:tuple[int, ...]=(2,2), stride=None, dilation=1, padding:int|tuple[int, ...]=0,
ceil_mode=False, count_include_pad=True) -> Tensor:
"""
Applies average pooling over a tensor.
This function supports three different types of `padding`
1. `int` (single value):
Applies the same padding value uniformly to all spatial dimensions.
2. `tuple[int, ...]` (length = number of spatial dimensions):
Specifies a distinct padding value for each spatial dimension in the form `(padding_height, padding_width, ...)`.
3. `tuple[int, ...]` (length = 2 * number of spatial dimensions):
Specifies explicit padding for each side of each spatial dimension in the form
`(padding_left, padding_right, padding_top, padding_bottom, ...)`.
When `ceil_mode` is set to `True`, output shape will be determined using ceil division.
When `count_include_pad` is set to `False`, zero padding will not be included in the averaging calculation.
NOTE: unlike PyTorch, this implementation is not limited to only 2d pooling and instead works for any number of dimensions.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.arange(25).reshape(1, 1, 5, 5)
print(t.avg_pool2d().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.avg_pool2d(ceil_mode=True).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.avg_pool2d(padding=1).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.avg_pool2d(padding=1, count_include_pad=False).numpy())
```
"""
axis = tuple(range(-len(k_ := make_tuple(kernel_size, 2)), 0))
def pool(x:Tensor, padding_:Sequence[int]) -> Tensor: return x.pad(padding_)._pool(k_, stride if stride is not None else k_, dilation)
reg_pads = self._resolve_pool_pads(padding, len(k_))
ceil_pads = self._apply_ceil_mode(reg_pads, k_, stride if stride is not None else k_, dilation)
if not count_include_pad:
pads = ceil_pads if ceil_mode else reg_pads
return pool(self, pads).sum(axis) / pool(self.ones_like(), pads).sum(axis)
if not ceil_mode: return pool(self, reg_pads).mean(axis)
return pool(self, ceil_pads).sum(axis) / pool(self.pad(reg_pads).ones_like(), tuple(cp-rp for cp,rp in zip(ceil_pads, reg_pads))).sum(axis)
def max_pool2d(self, kernel_size:tuple[int, ...]=(2,2), stride=None, dilation=1, padding:int|tuple[int, ...]=0,
ceil_mode=False, return_indices=False) -> Tensor | tuple[Tensor, Tensor]:
"""
Applies max pooling over a tensor.
This function supports three different types of `padding`
1. `int` (single value):
Applies the same padding value uniformly to all spatial dimensions.
2. `tuple[int, ...]` (length = number of spatial dimensions):
Specifies a distinct padding value for each spatial dimension in the form `(padding_height, padding_width, ...)`.
3. `tuple[int, ...]` (length = 2 * number of spatial dimensions):
Specifies explicit padding for each side of each spatial dimension in the form
`(padding_left, padding_right, padding_top, padding_bottom, ...)`.
When `ceil_mode` is set to `True`, output shape will be determined using ceil division.
When `return_indices` is set to `True`, the argmax will be returned along with the max values.
NOTE: unlike PyTorch, this implementation is not limited to only 2d pooling and instead works for any number of dimensions.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.arange(25).reshape(1, 1, 5, 5)
print(t.max_pool2d().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.max_pool2d(ceil_mode=True).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.max_pool2d(padding=1).numpy())
```
"""
axis = tuple(range(-len(k_ := make_tuple(kernel_size, 2)), 0))
pads = self._resolve_pool_pads(padding, len(k_))
if ceil_mode: pads = self._apply_ceil_mode(pads, k_, stride if stride is not None else k_, dilation)
pooled = self.pad(pads, value=dtypes.min(self.dtype))._pool(k_, stride if stride is not None else k_, dilation)
if not return_indices: return pooled.max(axis)
spatial_sz = int(math.prod(spatial_shape := self.shape[-len(k_):]))
idx = Tensor.arange(spatial_sz,0,-1, requires_grad=False, device=self.device).reshape(spatial_shape)
m = pooled == pooled.max(axis, keepdim=True)
idx = m * idx.pad(pads, value=dtypes.min(idx.dtype))._pool(k_, stride if stride is not None else k_, dilation)
return pooled.max(axis), spatial_sz - idx.max(axis)
def max_unpool2d(self, indices:Tensor, kernel_size:tuple[int, ...]=(2,2), stride=None, dilation=1, padding:int|tuple[int, ...]=0, output_size=None):
"""
Performs a partial inverse of `max_pool2d` using the indices from the argmax.
When `output_size` is provided, the output shape disambiguates to the provided shape.
NOTE: unlike PyTorch, this implementation is not limited to only 2d pooling and instead works for any number of dimensions.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.arange(1, 17).reshape(1, 1, 4, 4)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
output, indices = Tensor.max_pool2d(t, return_indices=True)
print(output.numpy())
print(indices.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.max_unpool2d(output, indices).numpy())
```
"""
bs,c,*spatial_shape = self.shape
if output_size is None:
k_,d_,s_ = (make_tuple(x, len(spatial_shape)) for x in (kernel_size, dilation, stride if stride is not None else kernel_size))
p_ = _flat_to_grouped(self._resolve_pool_pads(padding, len(spatial_shape)))
# https://arxiv.org/pdf/1603.07285 inverse of relationship 15 in section 5.1.
output_size = tuple((i-1)*s - (pB+pA) + (d*(k-1)+1) for i,k,d,s,(pA,pB) in zip(spatial_shape,k_,d_,s_,p_))
else: output_size = output_size[-len(spatial_shape):]
ret = (indices.reshape(bs,c,1,-1)._one_hot_along_dim(prod(output_size), 2).where(self.reshape(bs,c,1,-1), 0)).sum(3)
return ret.reshape(bs,c,*output_size)
def conv2d(self, weight:Tensor, bias:Tensor|None=None, groups=1, stride=1, dilation=1, padding:int|tuple[int, ...]=0,
dtype:DTypeLike|None=None) -> Tensor:
"""
Applies a convolution over a tensor with a given `weight` and optional `bias`.
This function supports three different types of `padding`
1. `int` (single value):
Applies the same padding value uniformly to all spatial dimensions.
2. `tuple[int, ...]` (length = number of spatial dimensions):
Specifies a distinct padding value for each spatial dimension in the form `(padding_height, padding_width, ...)`.
3. `tuple[int, ...]` (length = 2 * number of spatial dimensions):
Specifies explicit padding for each side of each spatial dimension in the form
`(padding_left, padding_right, padding_top, padding_bottom, ...)`.
NOTE: unlike PyTorch, this implementation is not limited to only 2d convolutions and instead works for any number of dimensions.
See: https://pytorch.org/docs/stable/generated/torch.nn.Conv2d.html
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.arange(9).reshape(1, 1, 3, 3)
w = Tensor.ones(1, 1, 2, 2)
print(t.conv2d(w).numpy())
```
"""
if IMAGE: return self.image_conv2d(weight, bias, groups, stride, dilation, padding, dtype)
(bs,cin_), (cout,cin), HW = self.shape[:2], weight.shape[:2], weight.shape[2:]
padding_ = self._resolve_pool_pads(padding, len(HW))
assert groups*cin == cin_ and len(self.shape) == len(weight.shape),\
f"Input Tensor shape {self.shape} does not match the shape of the weights {weight.shape}. ({groups*cin} vs. {cin_})"
# conv2d is a pooling op (with padding)
x = self.pad(padding_)._pool(HW, stride, dilation) # (bs, groups*cin, oy, ox, H, W)
rcout, oyx = cout//groups, x.shape[2:-len(HW)]
if not all(x == 3 for x in HW) or stride != 1 or dilation != 1 or not WINO:
# normal conv
x = x.reshape(bs, groups, cin, 1, *oyx, *HW).expand(bs, groups, cin, rcout, *oyx, *HW)\
.permute(0,1,3,*[4+i for i in range(len(oyx))],2,*[4+len(oyx)+i for i in range(len(HW))])
# conv! broadcasted to (bs, groups, rcout, *oyx, cin, *HW)
ret = (x * weight.reshape(1, groups, rcout, *[1] * len(oyx), cin, *HW))\
.sum([-1-i for i in range(1+len(oyx))], keepdim=True, dtype=dtype).reshape(bs, cout, *oyx)
return ret if bias is None else ret.add(bias.reshape(1, -1, *[1] * len(HW)))
HWI, HWO = (6,) * len(HW), (4,) * len(HW) # F(4x4,3x3) winograd tiles
winograd_G = [[1/4, 0, 0], [-1/6, -1/6, -1/6], [-1/6, 1/6, -1/6], [1/24, 1/12, 1/6], [1/24, -1/12, 1/6], [0, 0, 1]]
winograd_Bt = [[4, 0, -5, 0, 1, 0], [0, -4, -4, 1, 1, 0], [0, 4, -4, -1, 1, 0], [0, -2, -1, 2, 1, 0], [0, 2, -1, -2, 1, 0], [0, 4, 0, -5, 0, 1]]
winograd_At = [[1, 1, 1, 1, 1, 0], [0, 1, -1, 2, -2, 0], [0, 1, 1, 4, 4, 0], [0, 1, -1, 8, -8, 1]] # applying At in pre-order doubles compile time
# TODO: stride == dilation
# use padding to round up to 4x4 output tiles
# (bs, cin_, tyx, HWI)
pads = [[padding_[i*2], padding_[i*2+1] + (-(dim+sum(padding_[i*2:(i+1)*2])-2) % 4)] for i, dim in enumerate(reversed(self.shape[-len(HW):]))]
d = self.pad(sum(pads, []))._pool(HWI, HWO)
# move HW to the front: # (HWI, bs, cin_, tyx)
d = d.permute(*range(len(d.shape)-len(HW),len(d.shape)), *range(len(d.shape)-len(HW)))
tyx = d.shape[-len(HWI):] # dim of tiling
g = weight.permute(*range(len(weight.shape)-len(HW),len(weight.shape)), *range(len(weight.shape)-len(HW))) # move HW to the front
# compute 6x6 winograd tiles: GgGt, BtdB
# (HWI, groups * rcout, cin) -> (HWI, bs=1, groups, rcout, cin, tyx=(1,1))
gfactors = _apply_winograd_matrix(winograd_G, g, len(HW)).reshape(*HWI, 1, groups, rcout, cin, *([1]*len(tyx)))
# (HWI, bs, cin_, tyx) -> (HWI, bs, groups, 1 ,cin, *tyx)
dfactors = _apply_winograd_matrix(winograd_Bt, d, len(HW)).reshape(*HWI, bs, groups, 1, cin, *tyx)
# matmul; sum across cin: (HWI, bs, groups, rcout, *tyx); then HWI -> HWO: (HWO, bs, groups, rcout, *tyx)
ret = _apply_winograd_matrix(winograd_At, (gfactors * dfactors).sum(axis=-1-len(HW), dtype=dtype), len(HW))
# interleave tyx and HWO: (bs, groups, rcout, oy, HO, ox, WO)
ret = ret.permute([*range(len(HW), len(ret.shape)-len(HW)), *[i+o for i in range(len(HW)) for o in [len(ret.shape)-len(HW),0]]])
# merge groups and rcout, tyx and HWO: (bs, groups, cout, *yx), shrink to final
ret = ret.reshape(bs, cout, *[c * HWO[i] for i, c in enumerate(tyx)]).shrink(tuple((0, s) for s in [bs, cout, *oyx]))
return (ret if bias is None else ret.add(bias.reshape(1, -1, *[1 for _ in range(len(HW))]))).contiguous().contiguous_backward()
def conv_transpose2d(self, weight:Tensor, bias:Tensor|None=None, groups=1, stride=1, dilation=1, padding=0, output_padding=0) -> Tensor:
"""
Applies a transposed convolution over a tensor with a given `weight` and optional `bias`.
This function supports three different types of `padding`
1. `int` (single value):
Applies the same padding value uniformly to all spatial dimensions.
2. `tuple[int, ...]` (length = number of spatial dimensions):
Specifies a distinct padding value for each spatial dimension in the form `(padding_height, padding_width, ...)`.
3. `tuple[int, ...]` (length = 2 * number of spatial dimensions):
Specifies explicit padding for each side of each spatial dimension in the form
`(padding_left, padding_right, padding_top, padding_bottom, ...)`.
NOTE: unlike PyTorch, this implementation is not limited to only 2d transposed convolutions and instead works for any number of dimensions.
See: https://pytorch.org/docs/stable/generated/torch.nn.ConvTranspose2d.html
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.arange(9).reshape(1, 1, 3, 3)
w = Tensor.ones(1, 1, 2, 2)
print(t.conv_transpose2d(w).numpy())
```
"""
x, w = self, weight.unflatten(0, (groups, -1)).transpose(1, 2).flip(*range(3, len(weight.shape)+1))
HW = weight.shape[2:]
padding = _flat_to_grouped(self._resolve_pool_pads(padding, len(HW)))
stride, dilation, output_padding = [make_tuple(x, len(HW)) for x in (stride, dilation, output_padding)]
if any(s>1 for s in stride):
# handle strides: (k) -> reshape -> (k,1) -> pad -> (k,s) -> reshape -> (k*s) -> shrink (k-(s-1))
x = x.reshape(None, None, *flatten((k,1) for k in x.shape[2:]))
x = x.pad((None, None, *flatten((None,(0,s-1)) for s in stride)))
x = x.reshape(None, None, *[k*s for k,s in zip(x.shape[2::2], stride)])
x = x.shrink((None, None, *[(0,k-(s-1)) for k,s in zip(x.shape[2:], stride)]))
padding = flatten((((k-1)*d-pB,(k-1)*d-pA+op) for k,d,(pB,pA),op in reversed(list(zip(HW, dilation, padding, output_padding)))))
return x.conv2d(w.flatten(end_dim=1), groups=groups, bias=bias, dilation=dilation, padding=padding)
def dot(self, w:Tensor, dtype:DTypeLike|None=None) -> Tensor:
"""
Performs dot product between two tensors.
If `w` is 1-D, it's a sum product over the last axis of `self` and `w`.
If `w` is N-D with N>=2, it's a sum product over the last axis of `self` and the second-to-last axis of `w`.
You can pass in the optional `dtype` keyword argument to control the data type of the accumulation.
```python exec="true" source="above" session="tensor" result="python"
a = Tensor([1, 2, 3])
b = Tensor([1, 1, 0])
print(a.dot(b).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
a = Tensor([[1, 2], [3, 4]])
b = Tensor([[5, 6], [7, 8]])
print(a.dot(b).numpy())
```
"""
if IMAGE: return self.image_dot(w, dtype)
if ASM_GEMM:
from extra.gemm.asm.cdna.gemm import can_use_asm_gemm, asm_gemm
if can_use_asm_gemm(self, w): return asm_gemm(self, w)
x, dx, dw = self, self.ndim, w.ndim
if not (dx > 0 and dw > 0): raise RuntimeError(f"both tensors need to be at least 1D, got {dx}D and {dw}D")
if x.shape[-1] != w.shape[axis_w:=-min(w.ndim,2)]: raise RuntimeError(f"cannot dot {x.shape} and {w.shape}")
x = x.reshape(*x.shape[0:-1], *[1]*min(dx-1, dw-1, 1), x.shape[-1])
w = w.reshape(*w.shape[0:-2], *[1]*min(dx-1, dw-1, 1), *w.shape[axis_w:]).transpose(-1, axis_w)
return (x*w).sum(-1, dtype=dtype).cast(least_upper_dtype(x.dtype, w.dtype) if dtype is None else dtype)
def matmul(self, x:Tensor, reverse=False, dtype:DTypeLike|None=None) -> Tensor:
"""
Performs matrix multiplication between two tensors.
You can pass in the `reverse` keyword argument to control the order of the matrix multiplication.
You can pass in the optional `dtype` keyword argument to control the data type of the accumulation.
```python exec="true" source="above" session="tensor" result="python"
a = Tensor([[1, 2], [3, 4]])
b = Tensor([[5, 6], [7, 8]])
print(a.matmul(b).numpy())
```
"""
return x.dot(self, dtype=dtype) if reverse else self.dot(x, dtype=dtype)
def _cumalu(self, axis:int, op:Ops, _include_initial=False) -> Tensor:
assert self.shape[axis] != 0 and op in (Ops.ADD, Ops.MAX, Ops.MUL)
pl_sz = self.shape[axis] - int(not _include_initial)
pooled = self.transpose(axis,-1).pad((pl_sz, -int(_include_initial)), value=identity_element(op, self.dtype))._pool((self.shape[axis],))
return {Ops.ADD: pooled.sum(-1), Ops.MAX: pooled.max(-1), Ops.MUL: pooled.prod(-1)}[op].transpose(axis, -1)
def _split_cumalu(self, axis:int, op:Ops) -> Tensor:
axis = self._resolve_dim(axis)
if self.ndim == 0 or 0 in self.shape: return self
# TODO: someday the optimizer will find this on its own
# for now this is a two stage cumsum
SPLIT = 256
if not isinstance(s:=self.shape[axis], int) or s <= SPLIT*2: return self._cumalu(axis, op)
ret = self.transpose(axis,-1).pad((round_up(s, SPLIT)-s, 0), value=identity_element(op, self.dtype)).unflatten(-1, (-1, SPLIT))._cumalu(-1, op)
base = ret[..., -1]._cumalu(-1, op, _include_initial=True)
base = base.unsqueeze(-1).expand(*base.shape, ret.shape[-1])
def fix(x: Tensor) -> Tensor: return x.flatten(start_dim=-2)[..., -s:].transpose(axis,-1)
reduce_fxns: dict[Ops, Callable[[Tensor, Tensor], Tensor]] = {Ops.ADD: Tensor.__add__, Ops.MAX: Tensor.maximum, Ops.MUL: Tensor.__mul__}
return reduce_fxns[op](fix(ret), fix(base))
def cumsum(self, axis:int=0) -> Tensor:
"""
Computes the cumulative sum of the tensor along the specified `axis`.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.ones(2, 3)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.cumsum(1).numpy())
```
"""
return self._split_cumalu(axis, Ops.ADD)
def cumprod(self, axis:int) -> Tensor:
"""
Computes the cumulative product of the elements of the tensor along the specified `axis`.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.arange(1, 7).reshape(2, 3)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.cumprod(axis=0).numpy())
```
"""
return self._split_cumalu(axis, Ops.MUL)
def cummax(self, axis:int=0) -> tuple[Tensor, Tensor]:
"""
Computes the cumulative max of the tensor along `axis`, returning (values, indices).
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([0, 1, -1, 2, -2, 3, -3])
values, indices = t.cummax(0)
print(values.numpy())
print(indices.numpy())
```
"""
if self.ndim == 0: return self._split_cumalu(axis, Ops.MAX), Tensor.zeros(self.shape, dtype=dtypes.int32, device=self.device)
values, n = self._split_cumalu(axis, Ops.MAX), int(self.shape[axis])
x, values_t = self.transpose(axis, -1), values.transpose(axis, -1)
match = (x.unsqueeze(-1) == values_t.unsqueeze(-2)) * Tensor.ones(n, n, requires_grad=False, device=self.device).triu()
idx = (-(match * Tensor.arange(n, 0, -1, requires_grad=False, device=self.device).reshape(n, 1)).max(-2) + n).cast(dtypes.int32)
return values, idx.transpose(-1, axis)
def cummin(self, axis:int=0) -> tuple[Tensor, Tensor]:
"""
Computes the cumulative min of the tensor along `axis`, returning (values, indices).
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([0, 1, -1, 2, -2, 3, -3])
values, indices = t.cummin(0)
print(values.numpy())
print(indices.numpy())
```
"""
values, indices = self._inverse().cummax(axis)
return values._inverse(), indices
@staticmethod
def _tri(r:sint, c:sint, diagonal:int=0, device=None, requires_grad:bool|None=None) -> Tensor:
assert isinstance(r, int) and isinstance(c, int), f"does not support symbolic, getting {r=}, {c=}"
return (Tensor.arange(r, device=device).unsqueeze(-1) + diagonal <= Tensor.arange(c, device=device)).requires_grad_(requires_grad)
def triu(self, diagonal:int=0) -> Tensor:
"""
Returns the upper triangular part of the tensor, the other elements are set to 0.
The argument `diagonal` determines which diagonal is on the boundary. `diagonal = 0` means the main diagonal.
Positive `diagonal` means above the main diagonal, and negative `diagonal` means below the main diagonal.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[1, 2, 3, 4], [5, 6, 7, 8], [9, 10, 11, 12]])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.triu(diagonal=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.triu(diagonal=1).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.triu(diagonal=-1).numpy())
```
"""
return Tensor._tri(self.shape[-2], self.shape[-1], diagonal=diagonal, device=self.device).where(self, self.zeros_like())
def tril(self, diagonal:int=0) -> Tensor:
"""
Returns the lower triangular part of the tensor, the other elements are set to 0.
The argument `diagonal` determines which diagonal is on the boundary. `diagonal = 0` means the main diagonal.
Positive `diagonal` means above the main diagonal, and negative `diagonal` means below the main diagonal.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[1, 2, 3, 4], [5, 6, 7, 8], [9, 10, 11, 12]])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.tril(diagonal=0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.tril(diagonal=1).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.tril(diagonal=-1).numpy())
```
"""
return Tensor._tri(self.shape[-2], self.shape[-1], diagonal=diagonal+1, device=self.device).where(self.zeros_like(), self)
def interpolate(self, size:tuple[int, ...], mode:str="linear", align_corners:bool=False) -> Tensor:
"""
Downsamples or Upsamples to the input `size`, accepts 0 to N batch dimensions.
The interpolation algorithm is selected with `mode` which currently only supports `linear`, `nearest` and `nearest-exact`.
To run `bilinear` or `trilinear`, pass in a 2D or 3D size.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[1, 2, 3, 4], [21, 22, 23, 24], [41, 42, 43, 44]])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.interpolate(size=(2,3), mode="linear").numpy())
```
"""
assert isinstance(size, (tuple,list)) and all_int(size) and 0 < len(size) <= self.ndim, f"invalid {size=}"
assert mode in ("linear", "nearest", "nearest-exact"), "only supports linear, nearest or nearest-exact interpolate"
assert not (align_corners and mode != "linear"), "align_corners option can only be set with the interpolating mode linear"
x, expand = self, list(self.shape)
for i in range(-1,-len(size)-1,-1):
scale = (int(self.shape[i]) - int(align_corners)) / (size[i] - int(align_corners))
arr, reshape = Tensor.arange(size[i], dtype=dtypes.float32, device=self.device), [1] * self.ndim
reshape[i] = expand[i] = size[i]
if mode == "linear":
index = (scale*arr if align_corners else (scale*(arr+0.5))-0.5).clip(0, self.shape[i]-1)
low, high, perc = [y.reshape(reshape).expand(expand) for y in (index.floor().int(), index.ceil().int(), index - index.floor())]
x = x.gather(i, low).lerp(x.gather(i, high), perc)
else:
index = (scale*(arr+0.5) if mode=="nearest-exact" else scale*arr).cast(dtypes.int32).reshape(reshape).expand(expand)
x = x.gather(i, index)
return x.cast(self.dtype)
def _pre_scatter(self, dim:int, index:Tensor, src:Tensor) -> tuple[Tensor, Tensor]:
index, dim = index.to(self.device), self._resolve_dim(dim)
assert index.ndim == self.ndim == src.ndim, f"self.ndim, index.ndim and src.ndim must all equal, {self.ndim=} {index.ndim=} {src.ndim=}"
assert all((d == dim or self_ >= index_) and src_ >= index_ for d,(self_,index_,src_) in enumerate(zip(self.shape, index.shape, src.shape))), \
f"All dimensions of {index.shape=} should be <= to all dimensions of {src.shape=} and all dimensions except dimension {dim} of {self.shape=}"
if self.dtype != src.dtype: raise RuntimeError(f"expect {self.dtype=} to be equal to {src.dtype=}")
# shrink src to index shape to shrink away the unused values
src = src.shrink(tuple((0,s) for s in index.shape))
# prepare src and mask for reduce with respect to dim
src = src.unsqueeze(-1).expand(*src.shape, self.shape[dim]).transpose(-1, dim)
mask = index.unsqueeze(-1)._one_hot_along_dim(self.shape[dim]).transpose(-1, dim)
# pad src and mask to self.shape so that reduce can be done with padded values as no-ops
src, mask = (x.pad(tuple((0, self.shape[i] - x.shape[i]) if i != dim else None for i in range(self.ndim)) + (None,)) for x in (src, mask))
return src, mask
def scatter(self, dim:int, index:Tensor, src:Tensor|PyConst, reduce:Literal['multiply', 'add']|None=None) -> Tensor:
"""
Scatters `src` values along an axis specified by `dim`.
Apply `add` or `multiply` reduction operation with `reduce`.
NOTE: To use the `reduce` argument with a Tensor `src`, see `Tensor.scatter_reduce`.
```python exec="true" source="above" session="tensor" result="python"
src = Tensor.arange(1, 11).reshape(2, 5)
print(src.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
index = Tensor([[0, 1, 2, 0]])
print(Tensor.zeros(3, 5, dtype=src.dtype).scatter(0, index, src).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
index = Tensor([[0, 1, 2], [0, 1, 4]])
print(Tensor.zeros(3, 5, dtype=src.dtype).scatter(1, index, src).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.full((2, 4), 2.0).scatter(1, Tensor([[2], [3]]), 1.23, reduce='multiply').numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.full((2, 4), 2.0).scatter(1, Tensor([[2], [3]]), 1.23, reduce='add').numpy())
```
"""
if reduce not in {None, "add", "multiply"}: raise TypeError(f"{reduce=} must be one of None, 'multiply', or 'add'")
if reduce and isinstance(src, Tensor): raise TypeError("Tensor src is not supported with reduce arg. see scatter_reduce")
if not isinstance(src, Tensor): src = index.full_like(src, device=self.device, dtype=self.dtype)
if reduce == "add": return self.scatter_reduce(dim, index, src, "sum", include_self=True)
if reduce == "multiply": return self.scatter_reduce(dim, index, src, "prod", include_self=True)
src, mask = self._pre_scatter(dim, index, src)
return _masked_setitem(self, src, mask, (-1,))
def scatter_reduce(self, dim:int, index:Tensor, src:Tensor, reduce:Literal["sum", "prod", "mean", "amax", "amin"],
include_self:bool=True) -> Tensor:
"""
Scatters `src` values along an axis specified by `dim`.
Apply `"sum"`, `"prod"`, `"mean"`, `"amax"`, or `"amin"` reduction operations with `reduce`.
Set `include_self=False` to exclude values in the `self` Tensor from the reduction.
```python exec="true" source="above" session="tensor" result="python"
src = Tensor.arange(1, 11).cast(dtypes.float).reshape(2, 5)
print(src.numpy())
index = Tensor([[0, 0, 0, 0, 0], [0, 0, 0, 0, 0]])
print(index.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.ones(1, 5, dtype=src.dtype).scatter_reduce(0, index, src, reduce='sum').numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.ones(1, 5, dtype=src.dtype).scatter_reduce(0, index, src, reduce='prod').numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor.ones(1, 5, dtype=src.dtype).scatter_reduce(0, index, src, reduce='mean', include_self=False).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([[-10, 20, 0, 5, 10]], dtype=src.dtype).scatter_reduce(0, index, src, reduce='amax').numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([[-10, 20, 0, 5, 10]], dtype=src.dtype).scatter_reduce(0, index, src, reduce='amin').numpy())
```
"""
src, mask = self._pre_scatter(dim, index, src)
def _inv_mask(a:Tensor|PyConst, b:Tensor|PyConst) -> Tensor: return mask.any(-1).logical_not().where(a, b)
if reduce == "sum": return mask.where(src, 0).sum(-1).add(self if include_self else _inv_mask(self, 0))
if reduce == "prod": return mask.where(src, 1).prod(-1).mul(self if include_self else _inv_mask(self, 1))
if reduce == "amax": return mask.where(src, m := dtypes.min(src.dtype)).max(-1).maximum(self if include_self else _inv_mask(self, m))
if reduce == "amin": return mask.where(src, m := dtypes.max(src.dtype)).min(-1).minimum(self if include_self else _inv_mask(self, m))
if reduce == "mean":
count = mask.where(1, 0).sum(-1).add(1 if include_self else _inv_mask(1, 0))
return mask.where(src, 0).sum(-1).add(self if include_self else _inv_mask(self, 0)).div(count)
raise RuntimeError(f"{reduce=} must be one of 'sum', 'prod', 'mean', 'amax', 'amin'")
def sort(self, dim:int=-1, descending:bool=False) -> tuple[Tensor, Tensor]:
"""
Performs a bitonic sort on the tensor along the specified dimension.
Order of indices for equivalent elements is always preserved.
See: https://en.wikipedia.org/wiki/Bitonic_sorter
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[0.1, 0.5, 1.2, 3.4, 2.1], [2.2, 1.9, 0.3, 4.5, 0.8]])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
sorted_values, indices = t.sort(dim=1, descending=True)
print(sorted_values.numpy())
print(indices.numpy())
```
"""
x, dim = self, self._resolve_dim(dim)
if (orig_len := int(x.shape[dim])) <= 1: return x, x.zeros_like(dtype=dtypes.default_int)
# pad to power of 2
n_stages = (orig_len-1).bit_length()
pads = tuple((0, 2**n_stages - orig_len) if i == dim else None for i in range(x.ndim))
x = x.pad(pads, value=dtypes.min(x.dtype) if descending else dtypes.max(x.dtype)).unflatten(dim, (2,)*n_stages)
# https://en.wikipedia.org/wiki/Bitonic_sorter#/media/File:BitonicSort1.svg
for stage in range(1, n_stages+1):
if stage != n_stages:
# flip so arrows of green boxes point the same way as blue boxes
crossover_dim = dim + n_stages - stage - 1
blue_box, green_box = x.split(1, crossover_dim)
flip_dims = tuple(-i for i in range(1, stage+1+(self.ndim-dim)))
x = (blue_box.cat(green_box.flip(flip_dims), dim=crossover_dim)).contiguous()
for substage in range(stage-1, -1, -1):
partner_dim = dim + n_stages - substage - 1
x_top, x_bottom = x.split(1, partner_dim)
x_larger, x_smaller = x_top.maximum(x_bottom), x_top.minimum(x_bottom)
x = (x_larger.cat(x_smaller, dim=partner_dim) if descending else x_smaller.cat(x_larger, dim=partner_dim)).contiguous()
if stage != n_stages:
# flip wires back to undo the crossover
blue_box, flipped_green_box = x.split(1, crossover_dim)
x = blue_box.cat(flipped_green_box.flip(flip_dims), dim=crossover_dim)
x = x.flatten(dim, dim+n_stages-1).shrink(tuple((0, s) for s in self.shape))
# compute indices for sorted values
mask = Tensor.ones(orig_len, orig_len, dtype=dtypes.bool, device=self.device).tril().reshape((None, None) + (1,)*(self.ndim-dim-1))
def compute_counts(t:Tensor): return (mask & (t.unsqueeze(dim) == t.unsqueeze(dim+1))).sum(dim+1)
count_orig, count_sorted = compute_counts(self), compute_counts(x)
cond = (self.unsqueeze(dim+1) == x.unsqueeze(dim)) & (count_orig.unsqueeze(dim+1) == count_sorted.unsqueeze(dim))
idx = Tensor.arange(orig_len, device=self.device).reshape(tuple(orig_len if i == dim else 1 for i in range(x.ndim)))
idx = (cond * idx.unsqueeze(dim+1)).sum(dim)
return x, idx
def argsort(self, dim:int=-1, descending:bool=False) -> Tensor:
"""
Returns the indices that sort input tensor along given `dimension` in given `descending` order by value.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[2, 3, 4, 1], [1, 4, 3, 2]])
print(t.argsort().numpy())
```
"""
return self.sort(dim, descending)[1]
def topk(self, k:int, dim:int=-1, largest:bool=True, sorted_:bool=True) -> tuple[Tensor, Tensor]:
"""
Computes the top-k elements of the tensor along the specified `dim`.
Order of indices for equivalent elements is always preserved.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[0.1, 0.5, 1.2, 3.4, 2.1], [2.2, 1.9, 0.3, 4.5, 0.8]])
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
topk_values, topk_indices = t.topk(2, dim=1)
print(topk_values.numpy())
print(topk_indices.numpy())
```
"""
if not sorted_: raise NotImplementedError("topk with sorted_=False is not supported")
if k > self.shape[dim:=self._resolve_dim(dim)]: raise ValueError(f"selected index {k=} is out of range")
x, idx = self.sort(dim, descending=largest)
shrink_to_k = tuple((0, k) if i == dim else None for i in range(self.ndim))
return x.shrink(shrink_to_k), idx.shrink(shrink_to_k)
# ***** unary ops *****
def logical_not(self) -> Tensor:
"""
Computes the logical NOT of the tensor element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([False, True]).logical_not().numpy())
```
"""
return self.cast(dtypes.bool)._apply_broadcasted_uop(UOp.ne, True)
def neg(self) -> Tensor:
"""
Negates the tensor element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).neg().numpy())
```
"""
return self*-1 if self.dtype != dtypes.bool else self.logical_not()
def contiguous(self, *args, **kwargs) -> Tensor:
"""
Returns a contiguous tensor.
"""
return self._apply_uop(UOp.contiguous, extra_args=args, **kwargs)
def contiguous_backward(self) -> Tensor:
"""
Inserts a contiguous operation in the backward pass.
"""
return self._apply_uop(UOp.contiguous_backward)
def log(self) -> Tensor:
"""
Computes the natural logarithm element-wise.
See: https://en.wikipedia.org/wiki/Logarithm
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([1., 2., 4., 8.]).log().numpy())
```
"""
return self.log2()*math.log(2)
def log10(self) -> Tensor:
"""
Computes the base-10 logarithm element-wise.
See: https://en.wikipedia.org/wiki/Logarithm
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([1., 2., 4., 8.]).log10().numpy())
```
"""
return self.log2()*math.log10(2)
def log2(self) -> Tensor:
"""
Computes the base-2 logarithm element-wise.
See: https://en.wikipedia.org/wiki/Logarithm
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([1., 2., 4., 8.]).log2().numpy())
```
"""
return self.cast(least_upper_float(self.dtype))._apply_uop(UOp.log2)
def exp(self) -> Tensor:
"""
Computes the exponential function element-wise.
See: https://en.wikipedia.org/wiki/Exponential_function
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([0., 1., 2., 3.]).exp().numpy())
```
"""
# TODO: make it generic, and same thing to log and cos
if self.is_floating_point(): return self.cast(least_upper_dtype(self.dtype, dtypes.float32)).mul(1/math.log(2)).exp2().cast(self.dtype)
# TODO: behavior when DEFAULT_FLOAT is bfloat16 and input is int32?
return self.mul(1/math.log(2)).exp2()
def exp2(self) -> Tensor:
"""
Computes the base-2 exponential function element-wise.
See: https://en.wikipedia.org/wiki/Exponential_function
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([0., 1., 2., 3.]).exp2().numpy())
```
"""
return self.cast(least_upper_float(self.dtype))._apply_uop(UOp.exp2)
def logsigmoid(self) -> Tensor:
"""
Applies the LogSigmoid function element-wise.
- See: https://docs.pytorch.org/docs/stable/generated/torch.nn.functional.logsigmoid.html
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).logsigmoid().numpy())
```
"""
return -(-self).softplus()
def sqrt(self) -> Tensor:
"""
Computes the square root of the tensor element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([1., 2., 3., 4.]).sqrt().numpy())
```
"""
return self.cast(least_upper_float(self.dtype))._apply_uop(UOp.sqrt)
def sin(self) -> Tensor:
"""
Computes the sine of the tensor element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([0., math.pi/2, math.pi, 3*math.pi/2, 2*math.pi]).sin().numpy())
```
"""
return self.cast(least_upper_float(self.dtype))._apply_uop(UOp.sin)
def cos(self) -> Tensor:
"""
Computes the cosine of the tensor element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([0., math.pi/2, math.pi, 3*math.pi/2, 2*math.pi]).cos().numpy())
```
"""
if self.is_floating_point(): return ((math.pi/2)-self.cast(least_upper_dtype(self.dtype, dtypes.float32))).sin().cast(self.dtype)
return ((math.pi/2)-self).sin()
def tan(self) -> Tensor:
"""
Computes the tangent of the tensor element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([0., math.pi/4, math.pi/2, 3*math.pi/4, math.pi]).tan().numpy())
```
"""
return self.sin() / self.cos()
def asin(self) -> Tensor:
"""
Computes the inverse sine (arcsine) of the tensor element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-0.9, -0.6, -0.3, 0., 0.3, 0.6, 0.9]).asin().numpy())
```
"""
# https://personal.math.ubc.ca/~cbm/aands/page_81.htm 4.4.46
coefficients = [-0.0012624911, 0.0066700901, -0.0170881256, 0.0308918810, -0.0501743046, 0.0889789874, -0.2145988016, 1.5707963050]
x = math.pi / 2 - (1.0 - self.abs()).sqrt() * polyN(self.abs(), coefficients)
return self.sign() * x
def acos(self) -> Tensor:
"""
Computes the inverse cosine (arccosine) of the tensor element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-0.9, -0.6, -0.3, 0., 0.3, 0.6, 0.9]).acos().numpy())
```
"""
return math.pi / 2 - self.asin()
def atan(self) -> Tensor:
"""
Computes the inverse tangent (arctan) of the tensor element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).atan().numpy())
```
"""
return (self / (1 + self * self).sqrt()).asin()
# ***** math functions *****
def round(self: Tensor) -> Tensor:
"""
Rounds the tensor element-wise with rounding half to even.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3.5, -2.5, -1.5, -0.5, 0.5, 1.5, 2.5, 3.5]).round().numpy())
```
"""
return ((self > 0) == ((b := self.trunc() / 2.0).trunc() == b)).where((self - 0.5).ceil(), (self + 0.5).floor())
def lerp(self, end:Tensor, weight:Tensor|float) -> Tensor:
"""
Linearly interpolates between `self` and `end` by `weight`.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([1., 2., 3.]).lerp(Tensor([4., 5., 6.]), 0.5).numpy())
```
"""
if self.dtype == dtypes.uint8 and isinstance(weight, Tensor):
w_i = (weight * (1<<(W_PREC:=7)) + 0.5).cast(dtypes.int16)
return (self+(((end - self).cast(dtypes.int8) * w_i + (1<<W_PREC-1)).cast(dtypes.uint16) >> W_PREC)).cast(dtypes.uint8)
return self + (end - self) * weight
def sign(self) -> Tensor:
"""
Returns the sign of the tensor element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).sign().numpy())
```
"""
return self.ne(0).where((self<0).where(self.full_like(-1), self.full_like(1)), self.full_like(0)) + self*0
def abs(self) -> Tensor:
"""
Computes the absolute value of the tensor element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).abs().numpy())
```
"""
return self * self.sign()
def reciprocal(self) -> Tensor:
"""
Computes `1/x` element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([1., 2., 3., 4.]).reciprocal().numpy())
```
"""
return self.cast(least_upper_float(self.dtype))._apply_uop(UOp.reciprocal)
# ***** activation functions *****
def elu(self, alpha=1.0) -> Tensor:
"""
Applies the Exponential Linear Unit (ELU) function element-wise.
- Paper: https://arxiv.org/abs/1511.07289v5
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).elu().numpy())
```
"""
return self.relu() - alpha*(1-self.exp()).relu()
def celu(self, alpha=1.0) -> Tensor:
"""
Applies the Continuously differentiable Exponential Linear Unit (CELU) function element-wise.
- Paper: https://arxiv.org/abs/1704.07483
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).celu().numpy())
```
"""
return self.maximum(0) + (alpha * ((self / alpha).exp() - 1)).minimum(0)
def selu(self, alpha=1.67326, gamma=1.0507) -> Tensor:
"""
Applies the Scaled Exponential Linear Unit (SELU) function element-wise.
- Paper: https://arxiv.org/abs/1706.02515v5
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).selu().numpy())
```
"""
return gamma * (self >= 0).detach().where(self, alpha * (self.exp() - 1))
def sinh(self) -> Tensor:
"""
Applies the Hyperbolic Sine (sinh) function element-wise.
- Described: https://en.wikipedia.org/wiki/Hyperbolic_functions#Sinh
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).sinh().numpy())
```
"""
return (self.exp() - self.neg().exp()) / 2
def cosh(self) -> Tensor:
"""
Applies the Hyperbolic Cosine (cosh) function element-wise.
- Described: https://en.wikipedia.org/wiki/Hyperbolic_functions#Cosh
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).cosh().numpy())
```
"""
return (self.exp() + self.neg().exp()) / 2
def atanh(self) -> Tensor:
"""
Applies the Inverse Hyperbolic Tangent (atanh) function element-wise.
- Described: https://en.wikipedia.org/wiki/Inverse_hyperbolic_functions#atanh
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-0.9, -0.6, -0.3, 0., 0.3, 0.6, 0.9]).atanh().numpy())
```
"""
return ((1 + self)/(1 - self)).log() / 2
def asinh(self) -> Tensor:
"""
Applies the Inverse Hyperbolic Sine (asinh) function element-wise.
- Described: https://en.wikipedia.org/wiki/Inverse_hyperbolic_functions#asinh
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).asinh().numpy())
```
"""
return (self + (self.square() + 1).sqrt()).log()
def acosh(self) -> Tensor:
"""
Applies the Inverse Hyperbolic Cosine (acosh) function element-wise.
- Described: https://en.wikipedia.org/wiki/Inverse_hyperbolic_functions#acosh
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).acosh().numpy())
```
"""
return (self + (self.square() - 1).sqrt()).log()
def erf(self) -> Tensor:
"""
Applies error function element-wise.
- Described: https://en.wikipedia.org/wiki/Error_function
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-1.5, -1.0, -0.5, 0., 0.5, 1.0, 1.5]).erf().numpy())
```
"""
# https://personal.math.ubc.ca/~cbm/aands/page_299.htm 7.1.26
t = 1.0 / (1.0 + 0.3275911 * self.abs())
return self.sign() * (1.0 - t * polyN(t, [1.061405429, -1.453152027, 1.421413741, -0.284496736, 0.254829592]) * (-self.square()).exp())
def mish(self) -> Tensor:
"""
Applies the Mish function element-wise.
- Paper: https://arxiv.org/abs/1908.08681v3
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).mish().numpy())
```
"""
return self * self.softplus().tanh()
def softplus(self, beta=1.0) -> Tensor:
"""
Applies the Softplus function element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).softplus().numpy())
```
"""
return (1/beta) * (self*beta).logaddexp(0.0)
def softsign(self) -> Tensor:
"""
Applies the Softsign function element-wise.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-3., -2., -1., 0., 1., 2., 3.]).softsign().numpy())
```
"""
return self / (1 + self.abs())
# ***** broadcasted elementwise ops *****
def _broadcasted(self, y:Tensor|ConstType|UOp, reverse:bool=False, match_dtype:bool=True, backward_cast:bool=True) -> tuple[Tensor, Tensor]:
x: Tensor = self
if not isinstance(y, Tensor):
# make y a Tensor
assert isinstance(y, (*get_args(ConstType), UOp)), f"{type(y)=}, {y=}"
if isinstance(x.dtype, ImageDType) or dtypes.is_float(x.dtype) or (dtypes.is_int(x.dtype) and isinstance(y, int)): y_dtype = x.dtype
elif not isinstance(y, UOp): y_dtype = dtypes.from_py(y)
if isinstance(y, UOp): y = Tensor.from_uop(y, device=x.device)
else: y = Tensor(dtypes.as_const(y, y_dtype), x.device, y_dtype, requires_grad=False)
if match_dtype and x.dtype != y.dtype:
output_dtype = least_upper_dtype(x.dtype, y.dtype)
x, y = x.cast(output_dtype), y.cast(output_dtype)
if reverse: x, y = y, x
# compute the output shape
out_shape = _broadcast_shape(x.shape, y.shape)
# broadcast
# NOTE: the backward cast is no-op in forward and uses sum_acc_dtype in the backward sum
return x.cast(sum_acc_dtype(x.dtype) if backward_cast else x.dtype)._broadcast_to(out_shape).cast(x.dtype), \
y.cast(sum_acc_dtype(y.dtype) if backward_cast else y.dtype)._broadcast_to(out_shape).cast(y.dtype)
def sub(self, x:Tensor|ConstType, reverse=False) -> Tensor:
"""
Subtracts `x` from `self`.
Equivalent to `self - x`.
Supports broadcasting to a common shape, type promotion, and integer, float, boolean inputs.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor.randn(4)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.sub(20).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.sub(Tensor([[2.0], [3.5]])).numpy())
```
"""
a, b = self._broadcasted(x, reverse)
return a + (-b)
def div(self, x:Tensor|ConstType, reverse=False, rounding_mode:Literal["trunc", "floor"]|None=None) -> Tensor:
"""
Divides `self` by `x`.
Equivalent to `self / x`.
Supports broadcasting to a common shape, type promotion, and integer, float, boolean inputs.
`div` performs true division.
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor.randn(4)
print(t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.div(3).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([1, 4, 10]).div(Tensor([2, 3, 4])).numpy())
```
"""
numerator, denominator = self._broadcasted(x, reverse)
d = numerator.cast(least_upper_float(numerator.dtype)) * denominator.cast(least_upper_float(denominator.dtype)).reciprocal()
output_dtype = numerator.dtype if dtypes.is_int(numerator.dtype) else d.dtype
if dtypes.is_int(dt:=least_upper_dtype(numerator.dtype, denominator.dtype)) and rounding_mode is not None:
numerator, denominator = numerator.cast(dt), denominator.cast(dt)
if rounding_mode == "trunc": return numerator.idiv(denominator)
if rounding_mode == "floor":
truncate_div, truncate_mod = numerator.idiv(denominator), numerator._apply_broadcasted_uop(UOp.mod, denominator)
opposite_sign = ((numerator>0)&(denominator<0)) | ((numerator<0)&(denominator>0))
return (opposite_sign&(truncate_mod!=0)).where(truncate_div-1, truncate_div)
if rounding_mode == "trunc": return d.trunc().cast(output_dtype)
if rounding_mode == "floor": return d.floor().cast(output_dtype)
if rounding_mode is not None: raise RuntimeError(f"{rounding_mode=} is not supported")
return d
def mod(self, x:Tensor|ConstType, reverse=False) -> Tensor:
"""
Mod `self` by `x`.
Equivalent to `self % x`.
Supports broadcasting to a common shape, type promotion, and integer inputs.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-4, 7, 5, 4, -7, 8]).mod(Tensor([2, -3, 8, -2, 3, 5])).numpy())
```
"""
a, b = self._broadcasted(x, reverse)
return a - a.div(b, rounding_mode="floor") * b
def bitwise_not(self) -> Tensor:
"""
Computes the bitwise NOT of `self`.
Equivalent to `~self`.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([0, 2, 5, 255], dtype="int8").bitwise_not().numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([True, False]).bitwise_not().numpy())
```
"""
if self.dtype != dtypes.bool and not dtypes.is_int(self.dtype): raise RuntimeError(f"{self.dtype} is not supported")
return self.logical_not() if self.dtype == dtypes.bool else self ^ -1
def lshift(self, x:Tensor|int, reverse=False) -> Tensor:
"""
Computes left arithmetic shift of `self` by `x` bits. `self` must have unsigned dtype.
Equivalent to `self << x`.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([1, 3, 31], dtype=dtypes.uint8).lshift(2).numpy())
```
"""
assert dtypes.is_unsigned(self.dtype) and isinstance(x, int) and x >= 0 and not reverse, f"not supported {self.dtype=} {x=}"
return self.mul(2 ** x, reverse)
def rshift(self, x:Tensor|int, reverse=False) -> Tensor:
"""
Computes right arithmetic shift of `self` by `x` bits. `self` must have unsigned dtype.
Equivalent to `self >> x`.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([4, 13, 125], dtype=dtypes.uint8).rshift(2).numpy())
```
"""
assert dtypes.is_unsigned(self.dtype) and isinstance(x, int) and x >= 0 and not reverse, f"not supported {self.dtype=} {x=}"
return self.idiv(2 ** x, reverse)
def pow(self, x:Tensor|ConstType, reverse=False) -> Tensor:
"""
Computes power of `self` with `x`.
Equivalent to `self ** x`.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-1, 2, 3]).pow(2.0).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-1, 2, 3]).pow(Tensor([-1.5, 0.5, 1.5])).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print((2.0 ** Tensor([-1, 2, 3])).numpy())
```
"""
base, exponent = self._broadcasted(x, reverse=reverse)
# TODO: int pow
if not base.is_floating_point() and not (isinstance(x, int) and x >= 0): raise RuntimeError("base needs to be float")
ret = base._apply_uop(UOp.pow, exponent)
# NOTE: pow(int, float) -> int
return ret.round().cast(self.dtype) if not reverse and not dtypes.is_float(self.dtype) and dtypes.is_float(exponent.dtype) else ret
def maximum(self, x:Tensor|ConstType) -> Tensor:
"""
Computes element-wise maximum of `self` and `x`.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-1, 2, 3]).maximum(1).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-1, 2, 3]).maximum(Tensor([-4, -2, 9])).numpy())
```
"""
return self._apply_broadcasted_uop(UOp.maximum, x)
def minimum(self, x:Tensor|ConstType) -> Tensor:
"""
Computes element-wise minimum of `self` and `x`.
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-1, 2, 3]).minimum(1).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print(Tensor([-1, 2, 3]).minimum(Tensor([-4, -2, 9])).numpy())
```
"""
t, x = self._broadcasted(x)
return t._inverse().maximum(x._inverse())._inverse()
def where(self:Tensor, x:Tensor|ConstType|sint, y:Tensor|ConstType|sint) -> Tensor:
"""
Returns a tensor of elements selected from either `x` or `y`, depending on `self`.
`output_i = x_i if self_i else y_i`.
```python exec="true" source="above" session="tensor" result="python"
cond = Tensor([[True, True, False], [True, False, False]])
print(cond.where(1, 3).numpy())
```
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
cond = Tensor.randn(2, 3)
print(cond.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
print((cond > 0).where(cond, -float("inf")).numpy())
```
"""
if isinstance(x, Tensor): x, y = x._broadcasted(y)
elif isinstance(y, Tensor): y, x = y._broadcasted(x)
cond, x = self._broadcasted(x, match_dtype=False)
cond, y = cond._broadcasted(y, match_dtype=False)
return cond.cast(dtypes.bool)._apply_uop(UOp.where, *x._broadcasted(y))
def copysign(self, other) -> Tensor:
"""
Returns a tensor of with the magnitude of `self` and the sign of `other`, elementwise.
"""
# NOTE: torch always return in float, we return based on the broadcasting rule.
other = self._broadcasted(other)[1]
# TODO: remove other.sign()*0?
# other.sign()*0 keeps other in the gradient graph (gradient=0) without affecting forward (works for inf unlike other*0)
return self.abs() * ((other < 0) | (other.reciprocal() < 0)).where(-1, 1) + other.sign()*0
def logaddexp(self, other) -> Tensor:
"""
Calculates (self.exp()+other.exp()).log(), elementwise.
"""
m = self.maximum(other)
return ((self-m).exp() + (self._broadcasted(other)[1]-m).exp()).log() + m
# ***** op wrappers *****
def __invert__(self) -> Tensor: return self.bitwise_not()
# TODO: combine with UOps __floordiv__
def __floordiv__(self, x): return self.div(x, rounding_mode="floor")
def __rfloordiv__(self, x): return self.div(x, rounding_mode="floor", reverse=True)
def __pow__(self, x) -> Tensor: return self.pow(x)
def __matmul__(self, x) -> Tensor: return self.matmul(x)
def __rpow__(self, x) -> Tensor: return self.pow(x, True)
def __rmatmul__(self, x) -> Tensor: return self.matmul(x, True)
def __ifloordiv__(self, x) -> Tensor: return self.assign(self.__floordiv__(x))
def __ipow__(self, x) -> Tensor: return self.assign(self.pow(x))
def __imatmul__(self, x) -> Tensor: return self.assign(self.matmul(x))
# unlike Tensors, UOps are immutable, so these don't go in MathTraits
def __iadd__(self, x) -> Tensor: return self.assign(self.add(x)) # type: ignore[misc]
def __isub__(self, x) -> Tensor: return self.assign(self.sub(x)) # type: ignore[misc]
def __imul__(self, x) -> Tensor: return self.assign(self.mul(x)) # type: ignore[misc]
def __itruediv__(self, x) -> Tensor: return self.assign(self.div(x)) # type: ignore[misc]
def __iand__(self, x) -> Tensor: return self.assign(self.bitwise_and(x)) # type: ignore[misc]
def __ior__(self, x) -> Tensor: return self.assign(self.bitwise_or(x)) # type: ignore[misc]
def __ixor__(self, x) -> Tensor: return self.assign(self.bitwise_xor(x)) # type: ignore[misc]
def __ilshift__(self, x) -> Tensor: return self.assign(self.lshift(x)) # type: ignore[misc]
def __irshift__(self, x) -> Tensor: return self.assign(self.rshift(x)) # type: ignore[misc]
def __lt__(self, x) -> Tensor: return self._apply_broadcasted_uop(UOp.__lt__, x, False)
def __gt__(self, x) -> Tensor: return self._apply_broadcasted_uop(UOp.__lt__, x, True)
def ne(self, x) -> Tensor: return self._apply_broadcasted_uop(UOp.ne, x, False)
def __eq__(self, x) -> Tensor: return self.eq(x) # type: ignore[override]
# ***** encoding/decoding ops *****
def decode_hevc_frame(self, frame_pos:Variable, shape:tuple[int,...], state:Tensor, ref_frames:list[Tensor]|None=None) -> Tensor:
"""
Creates a Tensor by decoding an HEVC frame chunk.
You must provide the output shape of the decoded data (`shape`), the HEVC context (`vstate`), and, if required by the chunk,
the reference frames (`ref_frames`).
"""
ref_frames = [x.contiguous() for x in ref_frames or []]
assert isinstance(frame_pos, Variable), "frame_pos must be a Variable"
return self.contiguous()._apply_uop(UOp.encdec, state.contiguous(), *ref_frames, extra_args=(frame_pos,), arg=(shape,))
# ***** functional nn ops *****
def linear(self, weight:Tensor, bias:Tensor|None=None, dtype:DTypeLike|None=None) -> Tensor:
"""
Applies a linear transformation to `self` using `weight` and `bias`.
See: https://pytorch.org/docs/stable/generated/torch.nn.Linear.html
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[1, 2], [3, 4]])
weight = Tensor([[1, 2], [3, 4]])
bias = Tensor([1, 2])
print(t.linear(weight, bias).numpy())
```
"""
if dtype is not None: return self.cast(dtype).linear(weight.cast(dtype), bias.cast(dtype) if bias is not None else bias)
x = self.mul(weight) if len(weight.shape) == 1 else self.dot(weight)
return x.add(bias) if bias is not None else x
def sequential(self, ll:list[Callable[[Tensor], Tensor]]) -> Tensor:
"""
Applies a sequence of functions to `self` chaining the output of each function to the input of the next.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([1, 2, 3])
print(t.sequential([lambda x: x * 2, lambda x: x + 1]).numpy())
```
"""
return functools.reduce(lambda x,f: f(x), ll, self)
def layernorm(self, axis:int|tuple[int,...]=-1, eps:float=1e-5) -> Tensor:
"""
Applies Layer Normalization over a mini-batch of inputs.
- Paper: https://arxiv.org/abs/1607.06450v1
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.randn(8, 10, 16) * 2 + 8
print(t.mean().item(), t.std().item())
```
```python exec="true" source="above" session="tensor" result="python"
t = t.layernorm()
print(t.mean().item(), t.std().item())
```
"""
y = (self - self.mean(axis, keepdim=True))
return y.mul((y*y).mean(axis, keepdim=True).add(eps).rsqrt())
def batchnorm(self, weight:Tensor|None, bias:Tensor|None, mean:Tensor, invstd:Tensor, axis:int|tuple[int, ...]=1) -> Tensor:
"""
Applies Batch Normalization over a mini-batch of inputs.
- Paper: https://arxiv.org/abs/1502.03167
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.randn(8, 4, 16, 16) * 2 + 8
print(t.mean().item(), t.std().item())
```
```python exec="true" source="above" session="tensor" result="python"
t = t.batchnorm(None, None, t.mean(axis=(0,2,3)), t.var(axis=(0,2,3)).add(1e-5).rsqrt())
print(t.mean().item(), t.std().item())
```
"""
axis_ = argfix(axis)
shape = tuple(s if ax in axis_ else 1 for ax, s in enumerate(self.shape))
x = self - mean.reshape(shape)
if weight is not None: x = x * weight.reshape(shape)
ret = x.mul(invstd.reshape(shape) if len(invstd.shape) == len(axis_) else invstd)
return (ret + bias.reshape(shape)) if bias is not None else ret
def dropout(self, p=0.5) -> Tensor:
"""
Applies dropout to `self`.
NOTE: dropout is only applied when `Tensor.training` is `True`.
- Paper: https://jmlr.org/papers/v15/srivastava14a.html
```python exec="true" source="above" session="tensor" result="python"
Tensor.manual_seed(42)
t = Tensor.randn(2, 2)
with Tensor.train():
print(t.dropout().numpy())
```
"""
if not 0 <= p <= 1: raise ValueError(f"{p=} is out of range [0, 1]")
if not Tensor.training or p == 0: return self
if p == 1: return self.zeros_like()
return (Tensor.rand_like(self, requires_grad=False, dtype=dtypes.default_float, contiguous=False) >= p).contiguous().where(self, 0) / (1.0 - p)
# helper function commonly used for indexing
def _one_hot_along_dim(self:Tensor, num_classes:sint, dim:int=-1) -> Tensor:
if not dtypes.is_int(self.dtype): raise RuntimeError(f"_one_hot_along_dim expects int index tensor, getting {self.dtype}")
offset = self.ndim - self._resolve_dim(dim) - 1
dt = dtypes.int64 if sint_to_uop(num_classes).overflows(dtypes.int32) else dtypes.int32
return self == Tensor.arange(num_classes, dtype=dt, device=self.device, requires_grad=False).reshape((num_classes,) + (1,) * offset)
def one_hot(self, num_classes:int=-1) -> Tensor:
"""
Converts `self` to a one-hot tensor.
`num_classes` defaults to -1, which means num_classes will be inferred as max(self) + 1.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([0, 1, 3, 3, 4])
print(t.one_hot(5).numpy())
```
"""
if not dtypes.is_int(self.dtype): raise RuntimeError(f"expect integer dtype, getting {self.dtype=}")
if num_classes == -1: num_classes = int((self.max()+1).item())
return self[..., None]._one_hot_along_dim(num_classes).where(1, 0)
def scaled_dot_product_attention(self, key:Tensor, value:Tensor, attn_mask:Tensor|None=None, dropout_p:float=0.0,
is_causal:bool=False, enable_gqa:bool=False) -> Tensor:
"""
Computes scaled dot-product attention.
`self` is the query tensor, `key` is the key tensor, and `value` is the value tensor.
- Paper: https://arxiv.org/abs/1706.03762v7
```python exec="true" source="above" session="tensor" result="python"
q = Tensor.randn(2, 4, 8)
k = Tensor.randn(2, 4, 8)
v = Tensor.randn(2, 4, 8)
print(q.scaled_dot_product_attention(k, v).numpy())
```
"""
# NOTE: it also works when `key` and `value` have symbolic shape.
assert all_int(self.shape), f"does not support symbolic shape {self.shape}"
if getenv("FLASH_ATTENTION"):
from extra.thunder.tiny.fa import flash_attention
return flash_attention(self, key, value, attn_mask=attn_mask, is_causal=is_causal)
# GQA: https://docs.pytorch.org/docs/stable/generated/torch.nn.functional.scaled_dot_product_attention.html
if enable_gqa:
key = key.repeat_interleave(int(self.shape[-3] // key.shape[-3]), dim=-3)
value = value.repeat_interleave(int(self.shape[-3] // value.shape[-3]), dim=-3)
q = self
qk = q.matmul(key.transpose(-2,-1), dtype=least_upper_dtype(q.dtype, key.dtype, dtypes.float32)) / math.sqrt(q.shape[-1])
# handle attention mask
if is_causal:
if attn_mask is not None: raise RuntimeError("cannot set attn_mask when is_causal=True")
attn_mask = qk.ones_like(requires_grad=False, device=self.device, dtype=dtypes.bool).tril()
if attn_mask is not None:
if attn_mask.dtype == dtypes.bool: attn_mask = attn_mask.where(0, -float("inf"))
qk = qk + attn_mask
return qk.cast(self.dtype).softmax(-1).dropout(dropout_p) @ value
def _do_reduction(self, reduction:ReductionStr="mean") -> Tensor:
if reduction not in get_args(ReductionStr): raise ValueError(f"{reduction=} must be one of {get_args(ReductionStr)}")
reductions: dict[str, Callable[[Tensor], Tensor]] = {"mean": Tensor.mean, "sum": Tensor.sum, "none": lambda x: x}
return reductions[reduction](self)
def binary_crossentropy(self, Y:Tensor, reduction:ReductionStr="mean") -> Tensor:
"""
Computes the binary cross-entropy loss between `self` and `Y`.
See: https://pytorch.org/docs/stable/generated/torch.nn.BCELoss.html
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([0.1, 0.9, 0.2])
Y = Tensor([0, 1, 0])
print(t.binary_crossentropy(Y).item())
```
"""
return (-Y*self.log() - (1-Y)*(1-self).log())._do_reduction(reduction)
def binary_crossentropy_logits(self, Y:Tensor, reduction:ReductionStr="mean", pos_weight:Tensor|None=None) -> Tensor:
"""
Computes the binary cross-entropy loss between `self` and `Y` where `self` is logits.
See: https://pytorch.org/docs/stable/generated/torch.nn.BCEWithLogitsLoss.html
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([-1, 2, -3])
Y = Tensor([0, 1, 0])
print(t.binary_crossentropy_logits(Y).item())
```
"""
log_p, log_1_minus_p = self.logsigmoid(), (-self).logsigmoid()
return (-((1 if pos_weight is None else pos_weight) * Y * log_p + (1-Y) * log_1_minus_p))._do_reduction(reduction)
def sparse_categorical_crossentropy(self, Y:Tensor, ignore_index:int=-1, label_smoothing=0.0, reduction:ReductionStr="mean") -> Tensor:
"""
Computes the sparse categorical cross-entropy loss between `self` and `Y`.
NOTE: `self` is logits and `Y` is the target labels.
NOTE: unlike PyTorch, this function expects the class axis to be -1
See: https://pytorch.org/docs/stable/generated/torch.nn.CrossEntropyLoss.html
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[-1, 2, -3], [1, -2, 3]])
Y = Tensor([1, 2])
print(t.sparse_categorical_crossentropy(Y).item())
```
"""
assert 0.0 <= label_smoothing <= 1.0, "label_smoothing must be in [0.0, 1.0]"
assert reduction in get_args(ReductionStr), f"reduction must be one of {get_args(ReductionStr)}"
log_probs = self.log_softmax()
loss_mask = (Y != ignore_index) if ignore_index != -1 else Y.ones_like(dtype=dtypes.bool)
y = Y.to(self.device).unsqueeze(-1)._one_hot_along_dim(self.shape[-1], dim=-1) * loss_mask.unsqueeze(-1)
smoothing = label_smoothing * (log_probs.mean(-1) * loss_mask)
unreduced = ((1 - label_smoothing) * (log_probs * y).sum(-1) + smoothing)
# NOTE: because of ignore_index, we can't use Tensor.mean (so can't use `_do_reduction` here)
return -(unreduced.sum() / loss_mask.sum() if reduction == "mean" else (unreduced.sum() if reduction == "sum" else unreduced))
def cross_entropy(self, Y:Tensor, reduction:ReductionStr="mean", label_smoothing:float=0.0) -> Tensor:
"""
Computes the cross entropy loss between input logits and target.
NOTE: `self` are logits and `Y` are the target labels or class probabilities.
See: https://pytorch.org/docs/stable/generated/torch.nn.functional.cross_entropy.html
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[-1, 2, -3], [1, -2, 3]])
Y = Tensor([1, 2])
print(t.cross_entropy(Y).item())
```
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[-1, 2, -3], [1, -2, 3]])
Y = Tensor([1, 2])
print(t.cross_entropy(Y, reduction='none').numpy())
```
"""
assert 0.0 <= label_smoothing <= 1.0, "label_smoothing must be in [0.0, 1.0]"
classes_dim = 0 if self.ndim == 1 else 1
if self.shape != Y.shape:
if self.max(classes_dim).shape != Y.shape: raise RuntimeError(f"shape mismatch: {self.shape=}, {Y.shape=}")
Y = Y.unsqueeze(classes_dim)._one_hot_along_dim(num_classes=self.shape[classes_dim], dim=classes_dim)
Y = (1 - label_smoothing)*Y + label_smoothing / int(Y.shape[classes_dim])
return -self.log_softmax(classes_dim).mul(Y).sum(classes_dim)._do_reduction(reduction)
def nll_loss(self, Y:Tensor, weight:Tensor|None=None, ignore_index:int|None=None, reduction:ReductionStr="mean") -> Tensor:
"""
Computes the negative log likelihood loss between log-probabilities and target labels.
NOTE: `self` is log-probabilities and `Y` is the Y labels or class probabilities.
See: https://pytorch.org/docs/stable/generated/torch.nn.functional.nll_loss.html
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[-1, 2, -3], [1, -2, 3]])
Y = Tensor([1, 2])
print(t.log_softmax().nll_loss(Y).item())
```
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[-1, 2, -3], [1, -2, 3]])
Y = Tensor([1, 2])
print(t.log_softmax().nll_loss(Y, reduction='none').numpy())
```
"""
weight = Tensor.ones_like(Y, requires_grad=False) if weight is None else weight[Y]
masked_weight = weight if ignore_index is None else weight * (Y != ignore_index)
nll = -self.gather(1, Y.unsqueeze(1)).squeeze(1) * masked_weight
return nll.sum() / masked_weight.sum() if reduction == "mean" else nll._do_reduction(reduction)
def newton_schulz(self, steps:int, params:tuple[int, ...], eps:float=1.0e-7) -> Tensor:
"""
Performs the newton-schulz algorithm for odd polynomials. The degree of the odd polynomial depends on the number of params.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor.randn(4, 4)
print(t.newton_schulz(steps=5, params=(2,-1.5,0.5)).numpy())
```
"""
assert self.ndim > 1, "NS only works for two or more dims"
if self.shape[-2] > self.shape[-1]: return self.transpose(-2, -1).newton_schulz(steps, params, eps).transpose(-2, -1)
G = self / (self.square().sum(axis=(-2, -1), keepdim=True).sqrt() + eps)
for _ in range(steps):
G = cast(Tensor, sum(p * functools.reduce(lambda x, y: (y @ y.transpose(-2, -1)) @ x, [G]*i, G) for i,p in enumerate(params)))
return G
def qr(self) -> tuple[Tensor, Tensor]:
assert self.ndim > 1, f"expected two or more dimensions, got {self.ndim}"
b_shape, m, n = self.shape[:-2], int(self.shape[-2]), int(self.shape[-1])
R = self.clone()
Q = Tensor.eye(m, dtype=self.dtype).reshape((1,) * len(b_shape) + (m, m)).expand(b_shape + (m, m)).contiguous()
for i in range(min(m, n)):
x = R[..., i:m, i].contiguous() # TODO: without contigous this can silently be wrong, should at least assert
norm = x.square().sum(-1).sqrt()
s = (x[..., 0] != 0).where(-x[..., 0].sign(), -1)
u1 = x[..., 0] - s * norm
w = x.unsqueeze(-1) / (norm != 0).where(u1, 1).reshape(b_shape + (1, 1))
w[..., 0, 0] = 1
tau = (-s * u1 / (norm != 0).where(norm, 1)).reshape(b_shape + (1, 1))
tau = (norm != 0).reshape(b_shape + (1, 1)).where(tau, 0)
R[..., i:m, :] = R[..., i:m, :] - (w * tau) @ (w.transpose(-2, -1) @ R[..., i:m, :])
Q[..., :, i:m] = Q[..., :, i:m] - (Q[..., :, i:m] @ w) @ (tau * w).transpose(-2, -1)
return Q,R
def svd(self, full_matrices = True) -> tuple[Tensor, Tensor, Tensor]:
#partial implementation of https://www.netlib.org/lapack/lawnspdf/lawn169.pdf , pg 26
assert self.ndim > 1, f"expected two or more dimensions, got {self.ndim}"
b_shape, m, n = self.shape[:-2], int(self.shape[-2]), int(self.shape[-1])
#preprocess the matrix
Q, R = (self.qr() if m >= n else self.transpose(-2, -1).qr())
num, q_num = min(m, n), max(m, n)
U = R.shrink(tuple([None] * len(b_shape) + [(0, num), (0, num)])).contiguous()
V = Tensor.eye(num, dtype=self.dtype).reshape((1,) * len(b_shape) + (num, num)).expand(b_shape + (num, num)).contiguous()
#prepare round robin pairing
permute, inverse_permute = Tensor.arange(0, num, dtype=dtypes.int), Tensor.zeros(num, dtype=dtypes.int).contiguous()
permute[num//2:num] = permute[num//2:num].flip(0)
inverse_permute[permute] = Tensor.arange(num, dtype=dtypes.int)
def one_round_jacobi(U, V,permute,inverse_permute):
#pair all the columns
V_permuted, runoff_V = (V[..., permute].split(num - 1, -1)) if num % 2 == 1 else (V[..., permute], None)
V_left, V_right = V_permuted.split(num//2, -1)
U_permuted, runoff_U = (U[..., permute].split(num - 1, -1)) if num % 2 == 1 else (U[..., permute], None)
U_left, U_right = U_permuted.split(num//2, -1)
#compute the jacobi rotations for each pairing
gamma = (U_left * U_right).sum(-2).reshape(b_shape + (1, num//2))
alpha, beta = U_permuted.square().sum(-2).unsqueeze(-2).split(num//2, -1)
rot = gamma != 0
tau = (beta - alpha) / (2 * rot.where(gamma, 1))
t = (tau != 0).where(tau.sign(), 1) / (tau.abs() + (1 + tau.square()).sqrt())
t = rot.where(t, 0)
c = 1 / (1 + t.square()).sqrt()
s = c * t
#apply the rotations
U_left, U_right = c * U_left - s * U_right, s * U_left + c * U_right
U = U_left.cat(U_right.cat(runoff_U, dim = -1) if num % 2 == 1 else U_right, dim = -1)[..., inverse_permute]
V_left, V_right = c * V_left - s * V_right, s * V_left + c * V_right
V = V_left.cat(V_right.cat(runoff_V, dim = -1) if num % 2 == 1 else V_right, dim = -1)[..., inverse_permute]
#prepare the next round robin pairings
if num % 2 == 1: permute = ((permute - 1) % num)
else: permute = permute[0].reshape(1).cat(((permute[1:num] - 2) % (num - 1)) + 1)
inverse_permute = inverse_permute.scatter(0,permute,Tensor.arange(num,dtype=dtypes.int32))
return U, V, permute, inverse_permute
max_iterations, iterations_per_round = 1, int(num * math.log2(num) * 2 + 2)#sorta heuristic, most use num*log2(num)
for _ in range(max_iterations * iterations_per_round): U, V, permute, inverse_permute = one_round_jacobi(U, V, permute, inverse_permute)
#extract singular values and sort. construct U from Q
S, indices = U.square().sum(-2).sqrt().sort(dim = -1, descending=True)
new_indices = indices.reshape(b_shape + (1, num)).expand(b_shape + (num, num))
U = U.gather(-1, new_indices) / (S != 0).where(S, 1).unsqueeze(-2)
V = V.gather(-1, new_indices)
padded_u = Tensor.eye(q_num, dtype=U.dtype).reshape((1,) * len(b_shape) + (q_num, q_num)).expand(b_shape + (q_num, q_num)).contiguous()
padded_u[..., 0:num, 0:num] = U
U = Q @ padded_u
if not full_matrices: U, V = U[..., 0:num], V[..., 0:num]
return (U, S, V.transpose(-2,-1)) if m >= n else (V, S, U.transpose(-2, -1))
# ***** Tensor Properties *****
def element_size(self) -> int:
"""
Returns the size in bytes of an individual element in the tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([5], dtype=dtypes.int16)
print(t.element_size())
```
"""
return self.dtype.itemsize
def nbytes(self) -> int:
"""
Returns the total number of bytes of all elements in the tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([8, 9], dtype=dtypes.float)
print(t.nbytes())
```
"""
return int(self.numel()) * self.element_size()
def is_floating_point(self) -> bool:
"""
Returns `True` if the tensor contains floating point types, i.e. is one of `dtypes.float64`, `dtypes.float32`,
`dtypes.float16`, `dtypes.bfloat16`.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([8, 9], dtype=dtypes.float32)
print(t.is_floating_point())
```
"""
return dtypes.is_float(self.dtype)
def size(self, dim:int|None=None) -> sint|tuple[sint, ...]:
"""
Returns the size of the tensor. If `dim` is specified, return the length along dimension `dim`. Otherwise return the shape of the tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([[4, 5, 6], [7, 8, 9]])
print(t.size())
```
```python exec="true" source="above" session="tensor" result="python"
print(t.size(dim=1))
```
"""
return self.shape if dim is None else self.shape[dim]
# ***** cast ops *****
def cast(self, dtype:DTypeLike) -> Tensor:
"""
Casts `self` to the given `dtype`.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([-1, 2.5, 3], dtype=dtypes.float)
print(t.dtype, t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
t = t.cast(dtypes.int32)
print(t.dtype, t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
t = t.cast(dtypes.uint8)
print(t.dtype, t.numpy())
```
"""
if (dt:=to_dtype(dtype)) in {dtypes.uint8, dtypes.uint16} and dtypes.is_float(self.dtype):
# NOTE: values within the int32 range and outside the unsigned dtype range will cause values to wrap around
return self._apply_uop(UOp.cast, dtype=dtypes.int32)._apply_uop(UOp.cast, dtype=dt)
return self if self.dtype == dt else self._apply_uop(UOp.cast, dtype=dt)
def bitcast(self, dtype:DTypeLike) -> Tensor:
"""
Bitcasts `self` to the given `dtype`.
When the target dtype has the same itemsize, this is a view of the same memory.
When itemsizes differ, the last dimension is adjusted and a new Tensor is created.
`self` must not require a gradient.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([-1, 2, 3], dtype=dtypes.int32)
print(t.dtype, t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
t = t.bitcast(dtypes.uint32)
print(t.dtype, t.numpy())
```
"""
if self.requires_grad: raise RuntimeError("can't backprop through bitcast")
dt = to_dtype(dtype)
if (ns:=dt.itemsize) != (os:=self.dtype.itemsize) and (self.shape[-1]*os) % ns != 0: raise RuntimeError("unsupported size in bitcast")
if (not isinstance(self.device, str) or not self.device.startswith("DISK")) and ns != os:
new_uint, old_uint = to_dtype(f"uint{8*ns}"), to_dtype(f"uint{8*os}")
tmp = self.bitcast(old_uint)
if ns > os:
tmp = tmp.reshape(self.shape[:-1] + (self.shape[-1]//(rate := ns//os), rate))
nones = (None,) * (tmp.ndim - 1)
return functools.reduce(Tensor.add, (tmp.shrink(nones + ((i, i+1),)).cast(new_uint)<<8*i*os for i in range(rate))).squeeze(-1).bitcast(dtype)
return Tensor.stack(*(tmp>>8*i*ns for i in range(os//ns)), dim=-1).flatten(-2).cast(new_uint).bitcast(dtype)
return self._apply_uop(UOp.bitcast, dtype=dt) if self.dtype != dt else self
def float(self) -> Tensor:
"""
Convenience method to cast `self` to a `float32` Tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([-1, 2, 3], dtype=dtypes.int32)
print(t.dtype, t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
t = t.float()
print(t.dtype, t.numpy())
```
"""
return self.cast(dtypes.float32)
def half(self) -> Tensor:
"""
Convenience method to cast `self` to a `float16` Tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([-1, 2, 3], dtype=dtypes.int32)
print(t.dtype, t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
t = t.half()
print(t.dtype, t.numpy())
```
"""
return self.cast(dtypes.float16)
def int(self) -> Tensor:
"""
Convenience method to cast `self` to a `int32` Tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([-1.5, -0.5, 0.0, 0.5, 1.5])
print(t.dtype, t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
t = t.int()
print(t.dtype, t.numpy())
```
"""
return self.cast(dtypes.int32)
def bool(self) -> Tensor:
"""
Convenience method to cast `self` to a `bool` Tensor.
```python exec="true" source="above" session="tensor" result="python"
t = Tensor([-1, 0, 1])
print(t.dtype, t.numpy())
```
```python exec="true" source="above" session="tensor" result="python"
t = t.bool()
print(t.dtype, t.numpy())
```
"""
return self.cast(dtypes.bool)
def bfloat16(self) -> Tensor: return self.cast(dtypes.bfloat16)
def double(self) -> Tensor: return self.cast(dtypes.double)
def long(self) -> Tensor: return self.cast(dtypes.long)
def short(self) -> Tensor: return self.cast(dtypes.short)
# *** image Tensor function replacements ***
def image_dot(self, w:Tensor, dtype:DTypeLike|None=None) -> Tensor:
# NOTE: we use a 1x1 conv2d to do the matmul. mxk @ kxn = (1,k,m,1).conv2d(n,k,1,1)
if not (self.ndim > 0 and w.ndim > 0): raise RuntimeError(f"both tensors need to be at least 1D, got {self.ndim=}, {w.ndim=}")
if self.shape[-1] != w.shape[-min(w.ndim, 2)]: raise RuntimeError(f"cannot image_dot {self.shape} and {w.shape}")
bs, groups, cin, cout = prod(self.shape[0:-2]), prod(w.shape[0:-2]), w.shape[-2], w.shape[-1]
out_shape_t = self.shape[0:-2] + (cout,-1) if len(self.shape) > 1 else (cout,)
# NOTE: with NHWC we can remove the transposes
# bs x groups*cin x H x W
cx = self.transpose(self.ndim-1, self.ndim-2).reshape(bs//groups, groups*cin, -1, 1)
# groups*cout x cin x H, W
cw = w.transpose(w.ndim-1, w.ndim-2).reshape(groups*cout, cin, 1, 1)
return cx.image_conv2d(cw, groups=groups, dtype=dtype).reshape(out_shape_t).transpose(self.ndim-1, self.ndim-2)
def image_conv2d(self, weight:Tensor, bias:Tensor|None=None, groups=1, stride=1, dilation=1, padding=0, dtype=None) -> Tensor:
base_image_type, dtsz = (dtypes.imageh, 2) if (FLOAT16:=getenv("FLOAT16", 0)) else (dtypes.imagef, 4)
(bs,_,iy,ix), (cout,cin,H,W) = self.shape, weight.shape
x, w = self, weight.reshape(groups, (rcout := cout//groups), cin, H, W)
# hack for non multiples of 4 on cin
if cin % 4 != 0 and not (cin == 1 and groups%4 == 0):
x = x.reshape(bs, groups, cin, iy, ix) # do this always?
added_input_channels = 4 - (cin % 4)
cin = cin + added_input_channels
w = w.pad_to(None, None, cin, None, None)
x = x.pad_to(None, None, cin, None, None).reshape(bs, groups*cin, iy, ix)
# hacks for pitch alignment
if IMAGE == 1:
assert isinstance(ix, int) and isinstance(H, int)
added_width = 0
if (ix*groups*cin) % (64 // dtsz):
added_width = round_up(ix, 64 // (dtsz * math.gcd(groups * cin, 64 // dtsz))) - ix
ix = ix + added_width
x = x.pad_to(None, None, None, ix)
added_weight = 0
if (H*W*cin) % (64 // dtsz):
added_weight = round_up(H, 64 // (dtsz * math.gcd(W * cin, 64 // dtsz))) - H
H = H + added_weight
w = w.pad_to(None, None, None, H, None)
# hack for non multiples of 4 on rcout
added_output_channels = 0
if rcout % 4 != 0 and not (rcout == 1 and groups%4 == 0):
added_output_channels = 4 - (rcout % 4)
rcout += added_output_channels
cout = groups * rcout
w = w.pad_to(None, rcout, None, None, None)
# packed (note: flipping bs and iy would make the auto-padding work)
x = x.permute(0,2,3,1)
cin_last = iy == 1 and ix == 1
if cin == 1: w = w.reshape(cout//4,4,H,W).permute(0,2,3,1)
elif cin_last: w = w.reshape(cout//4,4,cin//4,4,H,W).permute(0,4,2,5,1,3)
else: w = w.reshape(cout//4,4,cin//4,4,H,W).permute(0,4,2,5,3,1)
# contiguous creates the image, and early realize static weights (TODO: test for the static weight)
if IMAGE >= 2: x,w = x.cast(base_image_type((bs*iy, ix*groups*cin//4, 4))), w.cast(base_image_type((cout//4, H*W*cin, 4)))
if IMAGE == 1 and FLOAT16: x, w = x.cast(dtypes.half).contiguous().cast(dtypes.float), w.cast(dtypes.half).contiguous().cast(dtypes.float)
else: x, w = x.contiguous(), w.contiguous()
if IMAGE == 1 and added_weight: w, H = w[:, :-added_weight, ...], H - added_weight
# expand out
rcin_hi, rcin_lo = (cin//4, 4) if cin >= 4 else (1, 1)
group_shape, rcout_expand = (groups//4, 4) if cin == 1 else (groups, 1), (rcout//4, 4) if rcout >= 4 else (1, 1)
x = x.reshape(bs, iy, -1, groups, rcin_hi, rcin_lo)
if cin_last: w = w.reshape(cout//4, H, rcin_hi, W, 4, rcin_lo)
else: w = w.reshape(cout//4, H, rcin_hi, W, rcin_lo, 4).permute(0,1,2,3,5,4)
# undo pitch alignment hack
if IMAGE == 1 and added_width: x = x[:, :, :-added_width, ...]
# prepare input
x = x.permute(0,3,4,5,1,2).pad(self._resolve_pool_pads(padding,2))._pool((H,W), stride, dilation)# -> (bs, groups, rcin_hi, rcin_lo, oy, ox, H, W)
x = x.permute(0,4,5,1,2,3,6,7).reshape(bs, (oy := x.shape[4]), (ox := x.shape[5]), *group_shape, 1, 1, rcin_hi, rcin_lo, H, W)
# prepare weights
w = w.permute(0,4,2,5,1,3).reshape((1, 1, 1, *group_shape, *rcout_expand, rcin_hi, rcin_lo, H, W))
if IMAGE == 1:
added_ox = 0
assert isinstance(ox, int) and isinstance(cout, int)
if (ox * cout) % (64 // dtsz):
added_ox = round_up(ox, 64 // (dtsz * math.gcd(cout, 64 // dtsz))) - ox
ox = ox + added_ox
x = x.pad_to(None, None, ox, None, None, None, None, None, None, None, None)
# the conv!
ret = (x*w).cast(base_image_type((bs*oy, ox*cout//4, 4)) if IMAGE >= 2 else dtypes.float32).sum((-4, -3, -2, -1), dtype=dtype)
if IMAGE == 1 and added_ox:
ret = ret.reshape(bs, oy, ox, groups, rcout)[:, :, :-added_ox, ...]
ox = ox - added_ox
# undo hack for non multiples of 4 on C.rcout
if added_output_channels != 0:
ret = ret.reshape(bs, oy, ox, groups, rcout)[:, :, :, :, :-added_output_channels]
cout = groups * (rcout - added_output_channels)
# NCHW output
ret = ret.reshape(bs, oy, ox, cout).permute(0,3,1,2)
return ret if bias is None else ret.add(bias.reshape(1, -1, 1, 1))
P = ParamSpec("P")
T = TypeVar("T")
# this tracks the tensor.py METADATA, contextvars.ContextVar was switched to this due to thread safety issues
class _ContextVar(Generic[T]):
def __init__(self, default:T): self.state:T = default
def get(self) -> T: return self.state
def set(self, x:T) -> T:
ret, self.state = self.state, x
return ret
_METADATA: _ContextVar[Metadata|None] = _ContextVar(default=None)
def _metadata_wrapper(fn: Callable[P, T]) -> Callable[P, T]:
def _wrapper(*args: P.args, **kwargs: P.kwargs) -> T:
if TRACEMETA < 1 or _METADATA.get() is not None: return fn(*args, **kwargs)
if TRACEMETA >= 2:
caller_frame = sys._getframe(frame := 1)
caller_module = caller_frame.f_globals.get("__name__", None)
caller_func = caller_frame.f_code.co_name
if caller_module is None: return fn(*args, **kwargs)
# if its called from nn we want to step up frames until we are out of nn
while caller_module.startswith("tinygrad.nn") and "optim" not in caller_module:
caller_frame = sys._getframe(frame := frame + 1)
caller_module = caller_frame.f_globals.get("__name__", None)
if caller_module is None: return fn(*args, **kwargs)
# if its called from a lambda in tinygrad we want to look two more frames up
if caller_module.startswith("tinygrad") and caller_func == "<lambda>": caller_frame = sys._getframe(frame := frame + 2)
caller_module = caller_frame.f_globals.get("__name__", None)
if caller_module is None: return fn(*args, **kwargs)
caller_func = caller_frame.f_code.co_name
caller_lineno = caller_frame.f_lineno
caller = f"{caller_module}:{caller_lineno}::{caller_func}"
else: caller = ""
token = _METADATA.set(Metadata(name=fn.__name__, caller=caller))
with cpu_profile(TracingKey(fn.__name__), "USER"):
ret = fn(*args, **kwargs)
_METADATA.set(token)
return ret
return _wrapper
if TRACEMETA >= 1:
for name, fn in inspect.getmembers(Tensor, inspect.isfunction):
if name in ["__class__", "__init__", "__new__", "__repr__", "backward", "sequential", "gradient"]: continue
setattr(Tensor, name, functools.wraps(fn)(_metadata_wrapper(fn)))